Difference between revisions of "DODECANOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] == * smiles: ** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-] * inchi key: ** InCh...")
 
(Created page with "Category:Gene == Gene Ec-00_007360 == * left end position: ** 11799898 * transcription direction: ** POSITIVE * right end position: ** 11800074 * centisome position: ** 62...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11740 CPD-11740] ==
+
== Gene Ec-00_007360 ==
−
* smiles:
+
* left end position:
−
** C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]
+
** 11799898
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** carboxyphosphinopyruvate
+
** 11800074
−
* molecular weight:
+
* centisome position:
−
** 193.029    
+
** 62.280315    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0552_0016
 +
** Esi0552_0016
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10828]]
+
* [[2.5.1.39-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-10827]]
+
***automated-name-match
−
== Reaction(s) of unknown directionality ==
+
* [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-11368]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-9003]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-9222]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN-9230]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY3O-19]]
 +
* [[PWY-6978]]
 +
* [[PWY-7235]]
 +
* [[PWY-6708]]
 +
* [[PWY-5855]]
 +
* [[PWY-5857]]
 +
* [[PWY-5856]]
 +
* [[PWY-5873]]
 +
* [[PWY-5872]]
 +
* [[PWY-5871]]
 +
* [[PWY-5870]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=11799898}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45479707 45479707]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(P(C([O-])=O)([O-])=O)C(=O)C(=O)[O-]}}
+
{{#set: right end position=11800074}}
−
{{#set: inchi key=InChIKey=YTKWPNBYPYOWCP-UHFFFAOYSA-K}}
+
{{#set: centisome position=62.280315    }}
−
{{#set: common name=carboxyphosphinopyruvate}}
+
{{#set: common name=Esi_0552_0016|Esi0552_0016}}
−
{{#set: molecular weight=193.029    }}
+
{{#set: reaction associated=2.5.1.39-RXN|4OHBENZOATE-OCTAPRENYLTRANSFER-RXN|RXN-11368|RXN-9003|RXN-9222|RXN-9230}}
−
{{#set: consumed by=RXN-10828}}
+
{{#set: pathway associated=PWY3O-19|PWY-6978|PWY-7235|PWY-6708|PWY-5855|PWY-5857|PWY-5856|PWY-5873|PWY-5872|PWY-5871|PWY-5870}}
−
{{#set: produced by=RXN-10827}}
+

Revision as of 21:43, 17 March 2018

Gene Ec-00_007360

  • left end position:
    • 11799898
  • transcription direction:
    • POSITIVE
  • right end position:
    • 11800074
  • centisome position:
    • 62.280315
  • Synonym(s):
    • Esi_0552_0016
    • Esi0552_0016

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=DODECANOATE&oldid=14195"