Difference between revisions of "3-HEXAPRENYL-4-HYDROXYBENZOATE"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * inchi key: ** InCh...") |
(Created page with "Category:Gene == Gene Ec-18_000770 == * left end position: ** 751968 * transcription direction: ** POSITIVE * right end position: ** 759551 * centisome position: ** 15.263...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-18_000770 == |
− | * | + | * left end position: |
− | ** | + | ** 751968 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 759551 |
− | * | + | * centisome position: |
− | ** | + | ** 15.26356 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0020_0103 |
− | ** | + | ** Esi0020_0103 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PEPTIDYLPROLYL-ISOMERASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***go-term |
− | + | == Pathways associated == | |
== External links == | == External links == | ||
− | + | {{#set: left end position=751968}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=759551}} | |
− | + | {{#set: centisome position=15.26356 }} | |
− | + | {{#set: common name=Esi_0020_0103|Esi0020_0103}} | |
− | + | {{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 22:43, 17 March 2018
Gene Ec-18_000770
- left end position:
- 751968
- transcription direction:
- POSITIVE
- right end position:
- 759551
- centisome position:
- 15.26356
- Synonym(s):
- Esi_0020_0103
- Esi0020_0103
Reactions associated
- PEPTIDYLPROLYL-ISOMERASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome