Difference between revisions of "3-HEXAPRENYL-4-HYDROXYBENZOATE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] == * smiles: ** C(OP([O-])([O-])=O)C([N+])C([O-])=O * inchi key: ** InCh...")
 
(Created page with "Category:Gene == Gene Ec-18_000770 == * left end position: ** 751968 * transcription direction: ** POSITIVE * right end position: ** 759551 * centisome position: ** 15.263...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=3-P-SERINE 3-P-SERINE] ==
+
== Gene Ec-18_000770 ==
−
* smiles:
+
* left end position:
−
** C(OP([O-])([O-])=O)C([N+])C([O-])=O
+
** 751968
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-phospho-L-serine
+
** 759551
−
* molecular weight:
+
* centisome position:
−
** 183.057    
+
** 15.26356    
 
* Synonym(s):
 
* Synonym(s):
−
** O-phospho-L-serine
+
** Esi_0020_0103
−
** L-serine phosphate
+
** Esi0020_0103
−
** phosphoryl-L-serine
+
−
** L-seryl phosphate
+
−
** L-serine-3P
+
−
** L-serine 3-phosphate
+
−
** 3-phospho-L-serine
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN0-5114]]
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
−
* [[PSERTRANSAM-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 407-41-0
+
{{#set: left end position=751968}}
−
* CAS : 17885-08-4
+
{{#set: transcription direction=POSITIVE}}
−
* PUBCHEM:
+
{{#set: right end position=759551}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=7059387 7059387]
+
{{#set: centisome position=15.26356   }}
−
* HMDB : HMDB00272
+
{{#set: common name=Esi_0020_0103|Esi0020_0103}}
−
* LIGAND-CPD:
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01005 C01005]
+
−
* CHEMSPIDER:
+
−
** [http://www.chemspider.com/Chemical-Structure.5415612.html 5415612]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57524 57524]
+
−
* BIGG : 36594
+
−
{{#set: smiles=C(OP([O-])([O-])=O)C([N+])C([O-])=O}}
+
−
{{#set: inchi key=InChIKey=BZQFBWGGLXLEPQ-REOHCLBHSA-L}}
+
−
{{#set: common name=3-phospho-L-serine}}
+
−
{{#set: molecular weight=183.057   }}
+
−
{{#set: common name=O-phospho-L-serine|L-serine phosphate|phosphoryl-L-serine|L-seryl phosphate|L-serine-3P|L-serine 3-phosphate|3-phospho-L-serine}}
+
−
{{#set: consumed by=RXN0-5114}}
+
−
{{#set: consumed or produced by=PSERTRANSAM-RXN}}
+

Revision as of 21:43, 17 March 2018

Gene Ec-18_000770

  • left end position:
    • 751968
  • transcription direction:
    • POSITIVE
  • right end position:
    • 759551
  • centisome position:
    • 15.26356
  • Synonym(s):
    • Esi_0020_0103
    • Esi0020_0103

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-HEXAPRENYL-4-HYDROXYBENZOATE&oldid=14198"