Difference between revisions of "CPD-8117"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DODECANOATE DODECANOATE] == * smiles: ** CCCCCCCCCCCC([O-])=O * inchi key: ** InChIKey=POULHZVO...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] == * smiles: ** C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11241 CPD-11241] == |
* smiles: | * smiles: | ||
− | ** | + | ** C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O)) |
* inchi key: | * inchi key: | ||
− | ** InChIKey= | + | ** InChIKey=LLVVMXFNKAHVEZ-GAWNPARCSA-L |
* common name: | * common name: | ||
− | ** | + | ** 4-(4-deoxy-α-D-galact-4-enuronosyl)-D-galacturonate |
* molecular weight: | * molecular weight: | ||
− | ** | + | ** 350.235 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 4-(4-deoxy-β-D-gluc-4-enuronosyl)-D-galacturonate |
− | ** | + | ** 4-(4-deoxy-β-D-gluc-4-enuronosyl)-galacturonate |
− | ** | + | ** 4-(4-deoxy-α-D-gluc-4-enuronosyl)-D-galacturonate |
− | ** | + | ** unsaturated digalacturonate |
− | ** | + | ** 4-(4-deoxy-α-D-gluc-4-enosyluronic acid)-D-galacturonic acid |
+ | ** 4-O-(4-deoxy-β-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-14897]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
− | |||
− | |||
− | |||
− | |||
* PUBCHEM: | * PUBCHEM: | ||
− | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878600 46878600] |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* CHEBI: | * CHEBI: | ||
− | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=60189 60189] |
− | * | + | * LIGAND-CPD: |
− | {{#set: smiles= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04733 C04733] |
− | {{#set: inchi key=InChIKey= | + | ** [http://www.genome.jp/dbget-bin/www_bget?C06118 C06118] |
− | {{#set: common name= | + | {{#set: smiles=C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O))}} |
− | {{#set: molecular weight= | + | {{#set: inchi key=InChIKey=LLVVMXFNKAHVEZ-GAWNPARCSA-L}} |
− | {{#set: common name= | + | {{#set: common name=4-(4-deoxy-α-D-galact-4-enuronosyl)-D-galacturonate}} |
− | {{#set: | + | {{#set: molecular weight=350.235 }} |
+ | {{#set: common name=4-(4-deoxy-β-D-gluc-4-enuronosyl)-D-galacturonate|4-(4-deoxy-β-D-gluc-4-enuronosyl)-galacturonate|4-(4-deoxy-α-D-gluc-4-enuronosyl)-D-galacturonate|unsaturated digalacturonate|4-(4-deoxy-α-D-gluc-4-enosyluronic acid)-D-galacturonic acid|4-O-(4-deoxy-β-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid}} | ||
+ | {{#set: produced by=RXN-14897}} |
Revision as of 21:43, 17 March 2018
Contents
Metabolite CPD-11241
- smiles:
- C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O))
- inchi key:
- InChIKey=LLVVMXFNKAHVEZ-GAWNPARCSA-L
- common name:
- 4-(4-deoxy-α-D-galact-4-enuronosyl)-D-galacturonate
- molecular weight:
- 350.235
- Synonym(s):
- 4-(4-deoxy-β-D-gluc-4-enuronosyl)-D-galacturonate
- 4-(4-deoxy-β-D-gluc-4-enuronosyl)-galacturonate
- 4-(4-deoxy-α-D-gluc-4-enuronosyl)-D-galacturonate
- unsaturated digalacturonate
- 4-(4-deoxy-α-D-gluc-4-enosyluronic acid)-D-galacturonic acid
- 4-O-(4-deoxy-β-L-threo-hex-4-enopyranosyluronic acid)-D-galactopyranuronic acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C([O-])(=O)C1(=CC(O)C(O)C(O1)OC2(C(O)C(C(O)OC(C([O-])=O)2)O))" cannot be used as a page name in this wiki.