Difference between revisions of "Ec-27 001550"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-8117 CPD-8117] == * smiles: ** CCCCCC=CCC=CCC=CCCCCC(=O)[O-] * inchi key: ** InChIKey=VZCCE...") |
(Created page with "Category:Gene == Gene Ec-27_002000 == * left end position: ** 1681033 * transcription direction: ** POSITIVE * right end position: ** 1689442 * centisome position: ** 26.0...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-27_002000 == |
− | * | + | * left end position: |
− | ** | + | ** 1681033 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1689442 |
− | * | + | * centisome position: |
− | ** | + | ** 26.062902 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0036_0058 |
− | ** | + | ** Esi0036_0058 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | + | * [[2.5.1.46-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***automated-name-match |
+ | * [[RXN-13414]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-13415]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-13416]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | * [[RXN-13417]] | ||
+ | ** esiliculosus_genome | ||
+ | ***automated-name-match | ||
+ | == Pathways associated == | ||
+ | * [[PWY-5905]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=1681033}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1689442}} | |
− | + | {{#set: centisome position=26.062902 }} | |
− | + | {{#set: common name=Esi_0036_0058|Esi0036_0058}} | |
− | + | {{#set: reaction associated=2.5.1.46-RXN|RXN-13414|RXN-13415|RXN-13416|RXN-13417}} | |
− | + | {{#set: pathway associated=PWY-5905}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:44, 17 March 2018
Gene Ec-27_002000
- left end position:
- 1681033
- transcription direction:
- POSITIVE
- right end position:
- 1689442
- centisome position:
- 26.062902
- Synonym(s):
- Esi_0036_0058
- Esi0036_0058
Reactions associated
- 2.5.1.46-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-13414
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-13415
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-13416
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome
- RXN-13417
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome