Difference between revisions of "CPD-13375"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-23_000610 == * left end position: ** 635004 * transcription direction: ** NEGATIVE * right end position: ** 641377 * centisome position: ** 13.121...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-DIPHOSPHATE OCTAPRENYL-DIPHOSPHATE] == * smiles: ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=OCTAPRENYL-DIPHOSPHATE OCTAPRENYL-DIPHOSPHATE] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=IKKLDISSULFFQO-DJMILUHSSA-K |
− | * | + | * common name: |
− | ** | + | ** all-trans-octaprenyl diphosphate |
− | * | + | * molecular weight: |
− | ** | + | ** 719.897 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** farnesylfarnesylgeranyl-PP |
− | ** | + | ** octaprenyl pyrophosphate |
− | ** | + | ** OPP |
+ | ** farnesylfarnesylgeraniol | ||
+ | ** octaprenyl diphosphate | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | * [[4OHBENZOATE-OCTAPRENYLTRANSFER-RXN]] |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04146 C04146] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57711 57711] |
− | {{#set: common name= | + | * BIGG : 43243 |
− | {{#set: | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245331 25245331] | ||
+ | * HMDB : HMDB01094 | ||
+ | {{#set: smiles=CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=IKKLDISSULFFQO-DJMILUHSSA-K}} | ||
+ | {{#set: common name=all-trans-octaprenyl diphosphate}} | ||
+ | {{#set: molecular weight=719.897 }} | ||
+ | {{#set: common name=farnesylfarnesylgeranyl-PP|octaprenyl pyrophosphate|OPP|farnesylfarnesylgeraniol|octaprenyl diphosphate}} | ||
+ | {{#set: consumed by=4OHBENZOATE-OCTAPRENYLTRANSFER-RXN}} |
Revision as of 21:44, 17 March 2018
Contents
Metabolite OCTAPRENYL-DIPHOSPHATE
- smiles:
- CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-]
- inchi key:
- InChIKey=IKKLDISSULFFQO-DJMILUHSSA-K
- common name:
- all-trans-octaprenyl diphosphate
- molecular weight:
- 719.897
- Synonym(s):
- farnesylfarnesylgeranyl-PP
- octaprenyl pyrophosphate
- OPP
- farnesylfarnesylgeraniol
- octaprenyl diphosphate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCCC(C)=CCOP(=O)([O-])OP(=O)([O-])[O-" cannot be used as a page name in this wiki.