Difference between revisions of "NICONUCADENYLYLTRAN-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] == * smiles: ** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1) * inchi key: *...")
 
(Created page with "Category:Gene == Gene Ec-04_005600 == * left end position: ** 5578540 * transcription direction: ** POSITIVE * right end position: ** 5582354 * centisome position: ** 85.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10488 CPD-10488] ==
+
== Gene Ec-04_005600 ==
−
* smiles:
+
* left end position:
−
** C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)
+
** 5578540
−
* inchi key:
+
* transcription direction:
−
** InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** N-formyl-D-kynurenine
+
** 5582354
−
* molecular weight:
+
* centisome position:
−
** 236.227    
+
** 85.6675    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0037_0010
 +
** Esi0037_0010
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PEPTIDYLPROLYL-ISOMERASE-RXN]]
−
* [[RXN-8664]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=5578540}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245041 25245041]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=5582354}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=55476 55476]
+
{{#set: centisome position=85.6675    }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0037_0010|Esi0037_0010}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C15605 C15605]
+
{{#set: reaction associated=PEPTIDYLPROLYL-ISOMERASE-RXN}}
−
* HMDB : HMDB01200
+
−
{{#set: smiles=C(=O)NC1(C(C(=O)CC([N+])C(=O)[O-])=CC=CC=1)}}
+
−
{{#set: inchi key=InChIKey=BYHJHXPTQMMKCA-UHFFFAOYSA-N}}
+
−
{{#set: common name=N-formyl-D-kynurenine}}
+
−
{{#set: molecular weight=236.227    }}
+
−
{{#set: produced by=RXN-8664}}
+

Revision as of 21:45, 17 March 2018

Gene Ec-04_005600

  • left end position:
    • 5578540
  • transcription direction:
    • POSITIVE
  • right end position:
    • 5582354
  • centisome position:
    • 85.6675
  • Synonym(s):
    • Esi_0037_0010
    • Esi0037_0010

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=NICONUCADENYLYLTRAN-RXN&oldid=14339"