Difference between revisions of "N-ACETYL-SEROTONIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] == * smiles: ** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO) * inchi k...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12521 RXN-12521] == * direction: ** LEFT-TO-RIGHT * common name: ** NAD(P)-binding domain * ec...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PYRIDOXINE-5P PYRIDOXINE-5P] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12521 RXN-12521] ==
−
* smiles:
+
* direction:
−
** CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L
+
 
* common name:
 
* common name:
−
** pyridoxine 5'-phosphate
+
** NAD(P)-binding domain
−
* molecular weight:
+
* ec number:
−
** 247.144   
+
** [http://enzyme.expasy.org/EC/1.3.1.34 EC-1.3.1.34]
 
* Synonym(s):
 
* Synonym(s):
−
** pyridoxol 5'-phosphate
 
−
** pyridoxine 5-phosphate
 
−
** pyridoxine phosphate
 
−
** pyridoxine-5P
 
−
** pyridoxine-P
 
−
** [5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[PNPOXI-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[NADPH]][c] '''+''' 1 [[TETRADEHYDROACYL-COA]][c] '''=>''' 1 [[NADP]][c] '''+''' 1 [[Trans-3-enoyl-CoAs]][c]
−
* [[PNKIN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 NADPH[c] '''+''' 1 a trans-2,trans-4-dienoyl-CoA[c] '''=>''' 1 NADP+[c] '''+''' 1 a trans-3-enoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-16_003950]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[PWY-6837]], fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6837 PWY-6837]
 +
** '''2''' reactions found over '''5''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 447-05-2
+
{{#set: direction=LEFT-TO-RIGHT}}
−
* BIGG : 35527
+
{{#set: common name=NAD(P)-binding domain}}
−
* PUBCHEM:
+
{{#set: ec number=EC-1.3.1.34}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=24794348 24794348]
+
{{#set: gene associated=Ec-16_003950}}
−
* HMDB : HMDB01319
+
{{#set: in pathway=PWY-6837}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00627 C00627]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEBI:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58589 58589]
+
−
* METABOLIGHTS : MTBLC58589
+
−
{{#set: smiles=CC1(=NC=C(COP([O-])(=O)[O-])C(=C(O)1)CO)}}
+
−
{{#set: inchi key=InChIKey=WHOMFKWHIQZTHY-UHFFFAOYSA-L}}
+
−
{{#set: common name=pyridoxine 5'-phosphate}}
+
−
{{#set: molecular weight=247.144    }}
+
−
{{#set: common name=pyridoxol 5'-phosphate|pyridoxine 5-phosphate|pyridoxine phosphate|pyridoxine-5P|pyridoxine-P|[5-hydroxy-4-(hydroxymethyl)-6-methylpyridin-3-yl]methyl phosphate}}
+
−
{{#set: consumed by=PNPOXI-RXN}}
+
−
{{#set: produced by=PNKIN-RXN}}
+

Revision as of 21:46, 17 March 2018

Reaction RXN-12521

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • NAD(P)-binding domain
  • ec number:
  • Synonym(s):

Reaction Formula

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • PWY-6837, fatty acid beta-oxidation V (unsaturated, odd number, di-isomerase-dependent): PWY-6837
    • 2 reactions found over 5 reactions in the full pathway

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=N-ACETYL-SEROTONIN&oldid=14391"