Difference between revisions of "RXN66-318"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-17_000820 == * left end position: ** 722814 * transcription direction: ** NEGATIVE * right end position: ** 745557 * centisome position: ** 15.065...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1828 CPD-1828] == * smiles: ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-1828 CPD-1828] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K |
− | * | + | * common name: |
− | ** | + | ** GDP-α-D-mannuronate |
− | * | + | * molecular weight: |
− | ** | + | ** 616.305 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GDP-mannuronic acid |
− | ** | + | ** GDP-α-D-mannuronic acid |
− | ** | + | ** GDP-mannuronate |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | * [[GDP-MANNOSE-6-DEHYDROGENASE-RXN]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=11966153 11966153] |
− | {{#set: | + | * CHEMSPIDER: |
− | {{#set: | + | ** [http://www.chemspider.com/Chemical-Structure.10140147.html 10140147] |
− | {{#set: common name= | + | * CHEBI: |
− | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=17466 17466] | |
− | {{#set: | + | * LIGAND-CPD: |
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C00976 C00976] | ||
+ | {{#set: smiles=C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))}} | ||
+ | {{#set: inchi key=InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K}} | ||
+ | {{#set: common name=GDP-α-D-mannuronate}} | ||
+ | {{#set: molecular weight=616.305 }} | ||
+ | {{#set: common name=GDP-mannuronic acid|GDP-α-D-mannuronic acid|GDP-mannuronate}} | ||
+ | {{#set: produced by=GDP-MANNOSE-6-DEHYDROGENASE-RXN}} |
Revision as of 21:47, 17 March 2018
Contents
Metabolite CPD-1828
- smiles:
- C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))
- inchi key:
- InChIKey=DNBSDUDYNPJVCN-ZXTXFPBHSA-K
- common name:
- GDP-α-D-mannuronate
- molecular weight:
- 616.305
- Synonym(s):
- GDP-mannuronic acid
- GDP-α-D-mannuronic acid
- GDP-mannuronate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])OP(=O)([O-])OC1(OC(C(=O)[O-])C(O)C(O)C(O)1))C2(OC(C(O)C(O)2)N4(C=NC3(C(=O)NC(N)=NC=34)))" cannot be used as a page name in this wiki.