Difference between revisions of "CPD-1828"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] == * smiles: ** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1) * inchi key: *...")
 
(Created page with "Category:Gene == Gene Ec-21_001630 == * left end position: ** 2652811 * transcription direction: ** NEGATIVE * right end position: ** 2660003 * centisome position: ** 35.9...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNOSE-1P MANNOSE-1P] ==
+
== Gene Ec-21_001630 ==
−
* smiles:
+
* left end position:
−
** C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)
+
** 2652811
−
* inchi key:
+
* transcription direction:
−
** InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** α-D-mannose 1-phosphate
+
** 2660003
−
* molecular weight:
+
* centisome position:
−
** 258.121    
+
** 35.945366    
 
* Synonym(s):
 
* Synonym(s):
−
** mannose-1-phosphate
+
** Esi_0147_0011
−
** D-mannose-1-phosphate
+
** Esi0147_0011
−
** mannose-1-P
+
** Ser Thr PK
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[2.7.7.13-RXN]]
+
* [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***ec-number
−
* [[PHOSMANMUT-RXN]]
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* CAS : 27251-84-9
+
{{#set: left end position=2652811}}
−
* PUBCHEM:
+
{{#set: transcription direction=NEGATIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245607 25245607]
+
{{#set: right end position=2660003}}
−
* HMDB : HMDB06330
+
{{#set: centisome position=35.945366   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0147_0011|Esi0147_0011|Ser Thr PK}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00636 C00636]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58409 58409]
+
−
* BIGG : 42578
+
−
{{#set: smiles=C(O)C1(OC(OP(=O)([O-])[O-])C(O)C(O)C(O)1)}}
+
−
{{#set: inchi key=InChIKey=HXXFSFRBOHSIMQ-RWOPYEJCSA-L}}
+
−
{{#set: common name=α-D-mannose 1-phosphate}}
+
−
{{#set: molecular weight=258.121   }}
+
−
{{#set: common name=mannose-1-phosphate|D-mannose-1-phosphate|mannose-1-P}}
+
−
{{#set: consumed by=2.7.7.13-RXN}}
+
−
{{#set: consumed or produced by=PHOSMANMUT-RXN}}
+

Revision as of 21:47, 17 March 2018

Gene Ec-21_001630

  • left end position:
    • 2652811
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 2660003
  • centisome position:
    • 35.945366
  • Synonym(s):
    • Esi_0147_0011
    • Esi0147_0011
    • Ser Thr PK

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-1828&oldid=14457"