Difference between revisions of "RXN-9514"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-11_002450 == * left end position: ** 2568155 * transcription direction: ** NEGATIVE * right end position: ** 2580481 * centisome position: ** 40.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10329 CPD-10329] == * smiles: ** CC1(OC(C(C(C1O)O)O)O) * inchi key: ** InChIKey=SHZGCJCMOBC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10329 CPD-10329] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC1(OC(C(C(C1O)O)O)O) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=SHZGCJCMOBCMKK-SXUWKVJYSA-N |
| − | * | + | * common name: |
| − | ** | + | ** α-L-fucopyranose |
| − | * | + | * molecular weight: |
| − | ** | + | ** 164.158 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** α-L-fucose |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | * [[RXN0-5298]] | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | == | + | |
| − | * [[ | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * DRUGBANK : DB04473 |
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=439554 439554] |
| − | {{#set: | + | * HMDB : HMDB00174 |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01019 C01019] | |
| − | {{#set: | + | * CHEMSPIDER: |
| + | ** [http://www.chemspider.com/Chemical-Structure.388645.html 388645] | ||
| + | * CHEBI: | ||
| + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=42548 42548] | ||
| + | {{#set: smiles=CC1(OC(C(C(C1O)O)O)O)}} | ||
| + | {{#set: inchi key=InChIKey=SHZGCJCMOBCMKK-SXUWKVJYSA-N}} | ||
| + | {{#set: common name=α-L-fucopyranose}} | ||
| + | {{#set: molecular weight=164.158 }} | ||
| + | {{#set: common name=α-L-fucose}} | ||
| + | {{#set: reversible reaction associated=RXN0-5298}} | ||
Revision as of 21:47, 17 March 2018
Contents
Metabolite CPD-10329
- smiles:
- CC1(OC(C(C(C1O)O)O)O)
- inchi key:
- InChIKey=SHZGCJCMOBCMKK-SXUWKVJYSA-N
- common name:
- α-L-fucopyranose
- molecular weight:
- 164.158
- Synonym(s):
- α-L-fucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- DRUGBANK : DB04473
- PUBCHEM:
- HMDB : HMDB00174
- LIGAND-CPD:
- CHEMSPIDER:
- CHEBI:
