Difference between revisions of "XANTHINE-OXIDASE-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PARAOXON PARAOXON] == * smiles: ** CCOP(OC1(C=CC(=CC=1)[N+]([O-])=O))(OCC)=O * inchi key: ** In...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkyl-glycerol-3-phosphate 1-Alkyl-glycerol-3-phosphate] == * common name: ** a 1-alkyl-sn-gl...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=1-Alkyl-glycerol-3-phosphate 1-Alkyl-glycerol-3-phosphate] == |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** a 1-alkyl-sn-glycerol 3-phosphate |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | |||
| − | |||
| − | |||
| − | |||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | * [[RXN- | + | * [[RXN-17729]] |
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
== External links == | == External links == | ||
| − | + | {{#set: common name=a 1-alkyl-sn-glycerol 3-phosphate}} | |
| − | + | {{#set: consumed by=RXN-17729}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: common name= | + | |
| − | + | ||
| − | + | ||
| − | {{#set: consumed by=RXN- | + | |
Revision as of 21:47, 17 March 2018
Contents
Metabolite 1-Alkyl-glycerol-3-phosphate
- common name:
- a 1-alkyl-sn-glycerol 3-phosphate
- Synonym(s):
