Difference between revisions of "RXN-10706"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2...")
 
(Created page with "Category:Gene == Gene Ec-21_001090 == * left end position: ** 1946897 * transcription direction: ** POSITIVE * right end position: ** 1953478 * centisome position: ** 26.3...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14893 CPD-14893] ==
+
== Gene Ec-21_001090 ==
−
* smiles:
+
* left end position:
−
** CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
+
** 1946897
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** ergost-7-enol
+
** 1953478
−
* molecular weight:
+
* centisome position:
−
** 400.687    
+
** 26.380291    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0025_0065
 +
** Esi0025_0065
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-13883]]
+
* [[MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***automated-name-match
 +
* [[RXN-7253]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
* [[RXN0-5408]]
 +
** esiliculosus_genome
 +
***automated-name-match
 +
== Pathways associated ==
 +
* [[PWY-4702]]
 +
* [[PWY-2301]]
 
== External links  ==
 
== External links  ==
−
* CAS : 516-78-9
+
{{#set: left end position=1946897}}
−
* PUBCHEM:
+
{{#set: transcription direction=POSITIVE}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657800 90657800]
+
{{#set: right end position=1953478}}
−
{{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4(C2(=CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}}
+
{{#set: centisome position=26.380291    }}
−
{{#set: inchi key=InChIKey=PUGBZUWUTZUUCP-ZRKHGVCBSA-N}}
+
{{#set: common name=Esi_0025_0065|Esi0025_0065}}
−
{{#set: common name=ergost-7-enol}}
+
{{#set: reaction associated=MYO-INOSITOL-1OR-4-MONOPHOSPHATASE-RXN|RXN-7253|RXN0-5408}}
−
{{#set: molecular weight=400.687    }}
+
{{#set: pathway associated=PWY-4702|PWY-2301}}
−
{{#set: consumed by=RXN-13883}}
+

Revision as of 21:48, 17 March 2018

Gene Ec-21_001090

  • left end position:
    • 1946897
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1953478
  • centisome position:
    • 26.380291
  • Synonym(s):
    • Esi_0025_0065
    • Esi0025_0065

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10706&oldid=14502"