Difference between revisions of "6PFRUCTPHOS-RXN"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-02_004960 == * left end position: ** 5265622 * transcription direction: ** POSITIVE * right end position: ** 5268339 * centisome position: ** 80.6...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == * smiles: ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO * inchi key: ** InChIKey=UYQ...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-725 CPD-725] == |
| − | * | + | * smiles: |
| − | ** | + | ** CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M |
| − | * | + | * common name: |
| − | ** | + | ** 13(S)-HPOTE |
| − | * | + | * molecular weight: |
| − | ** | + | ** 309.425 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 13(S)-hydroperoxylinolenic acid |
| − | ** | + | ** hydroperoxylinolenic acid |
| − | ** | + | ** 13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid |
| + | ** 13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate | ||
| + | ** 13(S)-hydroperoxylinolenate | ||
| + | ** (9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | == Reaction(s) known to produce the compound == |
| − | + | * [[RXN-1321]] | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | + | ||
| − | + | ||
| − | == | + | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | + | ||
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266757 45266757] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58757 58757] |
| − | {{#set: common name= | + | * LIGAND-CPD: |
| − | + | ** [http://www.genome.jp/dbget-bin/www_bget?C04785 C04785] | |
| − | {{#set: | + | {{#set: smiles=CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO}} |
| + | {{#set: inchi key=InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M}} | ||
| + | {{#set: common name=13(S)-HPOTE}} | ||
| + | {{#set: molecular weight=309.425 }} | ||
| + | {{#set: common name=13(S)-hydroperoxylinolenic acid|hydroperoxylinolenic acid|13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid|13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate|13(S)-hydroperoxylinolenate|(9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate}} | ||
| + | {{#set: produced by=RXN-1321}} | ||
Revision as of 21:48, 17 March 2018
Contents
Metabolite CPD-725
- smiles:
- CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO
- inchi key:
- InChIKey=UYQGVDXDXBAABN-FQSPHKRJSA-M
- common name:
- 13(S)-HPOTE
- molecular weight:
- 309.425
- Synonym(s):
- 13(S)-hydroperoxylinolenic acid
- hydroperoxylinolenic acid
- 13S-hydroperoxy-9(Z),11(E),15(Z)-octadecatrienoic acid
- 13(S)-hydroperoxy-(9Z,11E,15Z)-octadecatrienoate
- 13(S)-hydroperoxylinolenate
- (9Z,11E,15Z)-(13S)-hydroperoxyoctadeca-9,11,15-trienoate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CCC=CCC(C=CC=CCCCCCCCC([O-])=O)OO" cannot be used as a page name in this wiki.
