Difference between revisions of "ENOYL-COA-DELTA-ISOM-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2-Octenoyl-ACPs 2-Octenoyl-ACPs] == * common name: ** a trans oct-2-enoyl-[acp] * Synonym(s): *...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == |
+ | * smiles: | ||
+ | ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) | ||
+ | * inchi key: | ||
+ | ** InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M | ||
* common name: | * common name: | ||
− | ** | + | ** indoxyl sulfate |
+ | * molecular weight: | ||
+ | ** 212.2 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** indol-3-yl sulfate |
− | + | ||
− | + | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
− | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
+ | * [[RXN-15587]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=4453098 4453098] |
− | {{#set: | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=43355 43355] | ||
+ | * HMDB : HMDB00682 | ||
+ | {{#set: smiles=C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))}} | ||
+ | {{#set: inchi key=InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M}} | ||
+ | {{#set: common name=indoxyl sulfate}} | ||
+ | {{#set: molecular weight=212.2 }} | ||
+ | {{#set: common name=indol-3-yl sulfate}} | ||
+ | {{#set: reversible reaction associated=RXN-15587}} |
Revision as of 21:48, 17 March 2018
Contents
Metabolite CPD-16817
- smiles:
- C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))
- inchi key:
- InChIKey=BXFFHSIDQOFMLE-UHFFFAOYSA-M
- common name:
- indoxyl sulfate
- molecular weight:
- 212.2
- Synonym(s):
- indol-3-yl sulfate
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2))" cannot be used as a page name in this wiki.