Difference between revisions of "Ec-12 004360"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11641 CPD-11641] == * smiles: ** CC3(C2(C=CC(OC1(OC(CO)C(O)C(O)C(O)1))=CC=2OC(=O)C=3)) * in...") |
(Created page with "Category:Gene == Gene Ec-04_002790 == * left end position: ** 2900134 * transcription direction: ** POSITIVE * right end position: ** 2903510 * centisome position: ** 44.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-04_002790 == |
− | * | + | * left end position: |
− | ** | + | ** 2900134 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2903510 |
− | * | + | * centisome position: |
− | ** | + | ** 44.536243 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0244_0043 |
+ | ** Esi0244_0043 | ||
− | == | + | == Reactions associated == |
− | * [[RXN- | + | * [[SPERMIDINESYN-RXN]] |
− | + | ** esiliculosus_genome | |
− | == | + | ***go-term |
+ | * [[SPERMINE-SYNTHASE-RXN]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | == Pathways associated == | ||
+ | * [[ARGSPECAT-PWY]] | ||
+ | * [[BSUBPOLYAMSYN-PWY]] | ||
+ | * [[POLYAMINSYN3-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2900134}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2903510}} | |
− | + | {{#set: centisome position=44.536243 }} | |
− | + | {{#set: common name=Esi_0244_0043|Esi0244_0043}} | |
− | {{#set: | + | {{#set: reaction associated=SPERMIDINESYN-RXN|SPERMINE-SYNTHASE-RXN}} |
− | {{#set: | + | {{#set: pathway associated=ARGSPECAT-PWY|BSUBPOLYAMSYN-PWY|POLYAMINSYN3-PWY}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:48, 17 March 2018
Gene Ec-04_002790
- left end position:
- 2900134
- transcription direction:
- POSITIVE
- right end position:
- 2903510
- centisome position:
- 44.536243
- Synonym(s):
- Esi_0244_0043
- Esi0244_0043
Reactions associated
- SPERMIDINESYN-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- SPERMINE-SYNTHASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome