Difference between revisions of "SPERMIDINESYN-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-16817 CPD-16817] == * smiles: ** C2(C=CC1(=C(C(OS([O-])(=O)=O)=CN1)C=2)) * inchi key: ** In...") |
(Created page with "Category:Gene == Gene Ec-21_003280 == * left end position: ** 4244374 * transcription direction: ** NEGATIVE * right end position: ** 4248288 * centisome position: ** 57.5...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-21_003280 == |
− | * | + | * left end position: |
− | ** | + | ** 4244374 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4248288 |
− | * | + | * centisome position: |
− | ** | + | ** 57.510918 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0072_0034 |
+ | ** Esi0072_0034 | ||
− | == | + | == Reactions associated == |
− | + | * [[DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN]] | |
− | == | + | ** esiliculosus_genome |
− | * [[ | + | ***automated-name-match |
+ | == Pathways associated == | ||
+ | * [[TRIGLSYN-PWY]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4244374}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4248288}} | |
− | + | {{#set: centisome position=57.510918 }} | |
− | + | {{#set: common name=Esi_0072_0034|Esi0072_0034}} | |
− | {{#set: | + | {{#set: reaction associated=DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN}} |
− | {{#set: | + | {{#set: pathway associated=TRIGLSYN-PWY}} |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 22:49, 17 March 2018
Gene Ec-21_003280
- left end position:
- 4244374
- transcription direction:
- NEGATIVE
- right end position:
- 4248288
- centisome position:
- 57.510918
- Synonym(s):
- Esi_0072_0034
- Esi0072_0034
Reactions associated
- DIACYLGLYCEROL-O-ACYLTRANSFERASE-RXN
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome