Difference between revisions of "Ec-13 000360"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-20_000700 == * left end position: ** 665802 * transcription direction: ** POSITIVE * right end position: ** 669674 * centisome position: ** 12.912...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == |
− | * | + | * smiles: |
− | ** | + | ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O))) |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L |
− | * | + | * common name: |
− | ** | + | ** gibberellin A24 |
− | * | + | * molecular weight: |
− | ** | + | ** 344.407 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** GA24 |
− | + | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | + | * [[RXN1F-163]] | |
− | + | == Reaction(s) of unknown directionality == | |
− | == | + | |
== External links == | == External links == | ||
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906] |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861] |
+ | * HMDB : HMDB37103 | ||
+ | {{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}} | ||
+ | {{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}} | ||
+ | {{#set: common name=gibberellin A24}} | ||
+ | {{#set: molecular weight=344.407 }} | ||
+ | {{#set: common name=GA24}} | ||
+ | {{#set: produced by=RXN1F-163}} |
Revision as of 22:49, 17 March 2018
Contents
Metabolite CPD1F-120
- smiles:
- C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
- inchi key:
- InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
- common name:
- gibberellin A24
- molecular weight:
- 344.407
- Synonym(s):
- GA24
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))" cannot be used as a page name in this wiki.