Difference between revisions of "ExchangeSeed COB-I-ALAMIN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-22_002400 == * left end position: ** 2677752 * transcription direction: ** POSITIVE * right end position: ** 2684390 * centisome position: ** 59.2...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] == * smiles: ** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-22_002400 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-4201 CPD-4201] ==
−
* left end position:
+
* smiles:
−
** 2677752
+
** CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
−
* transcription direction:
+
* inchi key:
−
** POSITIVE
+
** InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
−
* right end position:
+
* common name:
−
** 2684390
+
** N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
−
* centisome position:
+
* molecular weight:
−
** 59.296734    
+
** 572.278    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0091_0014
+
** iPTP
−
** Esi0091_0014
+
** isopentenyladenosine riboside-5'-triphosphate
−
** MCC
+
** iPRTP
 +
** isopentenyladenosine-5'-triphosphate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[METHYLCROTONYL-COA-CARBOXYLASE-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-4303]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
** [[pantograph]]-[[aragem]]
+
−
== Pathways associated ==
+
−
* [[LEU-DEG2-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=2677752}}
+
* PUBCHEM:
−
{{#set: transcription direction=POSITIVE}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25203647 25203647]
−
{{#set: right end position=2684390}}
+
* CHEBI:
−
{{#set: centisome position=59.296734   }}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=71679 71679]
−
{{#set: common name=Esi_0091_0014|Esi0091_0014|MCC}}
+
* LIGAND-CPD:
−
{{#set: reaction associated=METHYLCROTONYL-COA-CARBOXYLASE-RXN}}
+
** [http://www.genome.jp/dbget-bin/www_bget?C16424 C16424]
−
{{#set: pathway associated=LEU-DEG2-PWY}}
+
{{#set: smiles=CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C}}
 +
{{#set: inchi key=InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K}}
 +
{{#set: common name=N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate}}
 +
{{#set: molecular weight=572.278   }}
 +
{{#set: common name=iPTP|isopentenyladenosine riboside-5'-triphosphate|iPRTP|isopentenyladenosine-5'-triphosphate}}
 +
{{#set: produced by=RXN-4303}}

Revision as of 21:49, 17 March 2018

Metabolite CPD-4201

  • smiles:
    • CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C
  • inchi key:
    • InChIKey=OPLVZTYVQUWKHB-SDBHATRESA-K
  • common name:
    • N6-(Δ2-isopentenyl)-adenosine 5'-triphosphate
  • molecular weight:
    • 572.278
  • Synonym(s):
    • iPTP
    • isopentenyladenosine riboside-5'-triphosphate
    • iPRTP
    • isopentenyladenosine-5'-triphosphate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CC(=CCNC3(=NC=NC2(N(C1(C(C(C(O1)COP(OP(=O)([O-])OP(=O)([O-])O)([O-])=O)O)O))C=NC=23)))C" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=ExchangeSeed_COB-I-ALAMIN&oldid=14640"