Difference between revisions of "GLC-1-P"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] == * smiles: ** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-]...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11213 RXN-11213] == * direction: ** LEFT-TO-RIGHT * common name: ** Methylmalonate Semialdehyde...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-120 CPD1F-120] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-11213 RXN-11213] ==
−
* smiles:
+
* direction:
−
** C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))
+
** LEFT-TO-RIGHT
−
* inchi key:
+
−
** InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L
+
 
* common name:
 
* common name:
−
** gibberellin A24
+
** Methylmalonate Semialdehyde Dehydrogenase
−
* molecular weight:
+
** Methylmalonate-semialdehyde dehydrogenase
−
** 344.407   
+
* ec number:
 +
** [http://enzyme.expasy.org/EC/1.2.1.27 EC-1.2.1.27]
 
* Synonym(s):
 
* Synonym(s):
−
** GA24
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
== Reaction(s) known to produce the compound ==
+
* With identifiers:
−
* [[RXN1F-163]]
+
** 1 [[CH3-MALONATE-S-ALD]][c] '''+''' 1 [[CO-A]][c] '''+''' 1 [[NAD]][c] '''+''' 1 [[WATER]][c] '''=>''' 1 [[HCO3]][c] '''+''' 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[PROPIONYL-COA]][c]
−
== Reaction(s) of unknown directionality ==
+
* With common name(s):
 +
** 1 (S)-methylmalonate-semialdehyde[c] '''+''' 1 coenzyme A[c] '''+''' 1 NAD+[c] '''+''' 1 H2O[c] '''=>''' 1 hydrogen carbonate[c] '''+''' 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 propanoyl-CoA[c]
 +
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-10_003810]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
* [[Ec-06_003440]]
 +
** ESILICULOSUS_GENOME
 +
***EC-NUMBER
 +
== Pathways  ==
 +
* [[VALDEG-PWY]], L-valine degradation I: [http://metacyc.org/META/NEW-IMAGE?object=VALDEG-PWY VALDEG-PWY]
 +
** '''8''' reactions found over '''8''' reactions in the full pathway
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
* RHEA:
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25246232 25246232]
+
** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=20804 20804]
−
* CHEBI:
+
* LIGAND-RXN:
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=32906 32906]
+
** [http://www.genome.jp/dbget-bin/www_bget?R00935 R00935]
−
* LIGAND-CPD:
+
{{#set: direction=LEFT-TO-RIGHT}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11861 C11861]
+
{{#set: common name=Methylmalonate Semialdehyde Dehydrogenase}}
−
* HMDB : HMDB37103
+
{{#set: common name=Methylmalonate-semialdehyde dehydrogenase}}
−
{{#set: smiles=C=C1(C2(CC3(C1)(C([CH]4(C(C)(CCCC(C=O)([CH](CC2)3)4)C([O-])=O))C([O-])=O)))}}
+
{{#set: ec number=EC-1.2.1.27}}
−
{{#set: inchi key=InChIKey=QQRSSHFHXYSOMF-CXXOJBQZSA-L}}
+
{{#set: gene associated=Ec-10_003810|Ec-06_003440}}
−
{{#set: common name=gibberellin A24}}
+
{{#set: in pathway=VALDEG-PWY}}
−
{{#set: molecular weight=344.407    }}
+
{{#set: reconstruction category=annotation}}
−
{{#set: common name=GA24}}
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
{{#set: produced by=RXN1F-163}}
+
{{#set: reconstruction tool=pathwaytools}}

Revision as of 21:50, 17 March 2018

Reaction RXN-11213

  • direction:
    • LEFT-TO-RIGHT
  • common name:
    • Methylmalonate Semialdehyde Dehydrogenase
    • Methylmalonate-semialdehyde dehydrogenase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 (S)-methylmalonate-semialdehyde[c] + 1 coenzyme A[c] + 1 NAD+[c] + 1 H2O[c] => 1 hydrogen carbonate[c] + 1 NADH[c] + 1 H+[c] + 1 propanoyl-CoA[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

  • VALDEG-PWY, L-valine degradation I: VALDEG-PWY
    • 8 reactions found over 8 reactions in the full pathway

Reconstruction information

External links





Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=GLC-1-P&oldid=14649"