Difference between revisions of "Ec-18 003900"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15068 RXN-15068] == * direction: ** LEFT-TO-RIGHT * common name: ** phospholipase A2 * ec numbe...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] == * smiles: ** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-15068 RXN-15068] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15637 CPD-15637] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
 +
* inchi key:
 +
** InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
 
* common name:
 
* common name:
−
** phospholipase A2
+
** 6-cis-tridecenoyl-CoA
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.1.1.4 EC-3.1.1.4]
+
** 957.819   
 
* Synonym(s):
 
* Synonym(s):
 +
** 6Z-tridecenoyl-CoA
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
* [[RXN-14771]]
−
** 1 [[WATER]][c] '''+''' 1 [[CPD-8268]][c] '''=>''' 1 [[L-1-LYSOPHOSPHATIDATE]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[OLEATE-CPD]][c]
+
== Reaction(s) known to produce the compound ==
−
* With common name(s):
+
== Reaction(s) of unknown directionality ==
−
** 1 H2O[c] '''+''' 1 dioleoyl phosphatidate[c] '''=>''' 1 1-oleyl-2-lyso-phosphatidate[c] '''+''' 1 H+[c] '''+''' 1 oleate[c]
+
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-04_004650]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
* [[Ec-21_005150]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-7417]], phospholipid remodeling (phosphatidate, yeast): [http://metacyc.org/META/NEW-IMAGE?object=PWY-7417 PWY-7417]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
−
{{#set: common name=phospholipase A2}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90659199 90659199]
−
{{#set: ec number=EC-3.1.1.4}}
+
{{#set: smiles=CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}}
−
{{#set: gene associated=Ec-04_004650|Ec-21_005150}}
+
{{#set: inchi key=InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J}}
−
{{#set: in pathway=PWY-7417}}
+
{{#set: common name=6-cis-tridecenoyl-CoA}}
−
{{#set: reconstruction category=annotation}}
+
{{#set: molecular weight=957.819    }}
−
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: common name=6Z-tridecenoyl-CoA}}
−
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: consumed by=RXN-14771}}

Revision as of 21:50, 17 March 2018

Metabolite CPD-15637

  • smiles:
    • CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
  • inchi key:
    • InChIKey=UUIVZEBYPBPKLL-DXAZUOFZSA-J
  • common name:
    • 6-cis-tridecenoyl-CoA
  • molecular weight:
    • 957.819
  • Synonym(s):
    • 6Z-tridecenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCCC=CCCCCC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-18_003900&oldid=14696"