Difference between revisions of "CPD0-2113"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] == * smiles: ** CC(C)=...")
 
(Created page with "Category:Gene == Gene Ec-13_000360 == * left end position: ** 1156771 * transcription direction: ** POSITIVE * right end position: ** 1166734 * centisome position: ** 16.6...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL 5-ALPHA-CHOLESTA-724-DIEN-3-BETA-OL] ==
+
== Gene Ec-13_000360 ==
−
* smiles:
+
* left end position:
−
** CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))
+
** 1156771
−
* inchi key:
+
* transcription direction:
−
** InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 5α-cholesta-7,24-dien-3β-ol
+
** 1166734
−
* molecular weight:
+
* centisome position:
−
** 384.644    
+
** 16.677141    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0191_0048
 +
** Esi0191_0048
 +
** CDKI1
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-11887]]
+
* [[PROTEIN-KINASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1156771}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=5459827 5459827]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1166734}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=16290 16290]
+
{{#set: centisome position=16.677141    }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0191_0048|Esi0191_0048|CDKI1}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C05439 C05439]
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
* HMDB : HMDB06842
+
−
{{#set: smiles=CC(C)=CCCC(C)[CH]1(CC[CH]3(C(C)1CC[CH]2(C4(C)([CH](CC=C23)CC(O)CC4))))}}
+
−
{{#set: inchi key=InChIKey=PKEPPDGGTSZLBL-SKCNUYALSA-N}}
+
−
{{#set: common name=5α-cholesta-7,24-dien-3β-ol}}
+
−
{{#set: molecular weight=384.644    }}
+
−
{{#set: consumed by=RXN-11887}}
+

Revision as of 21:50, 17 March 2018

Gene Ec-13_000360

  • left end position:
    • 1156771
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1166734
  • centisome position:
    • 16.677141
  • Synonym(s):
    • Esi_0191_0048
    • Esi0191_0048
    • CDKI1

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD0-2113&oldid=14697"