Difference between revisions of "RXN-7790"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHOSPHORYL-CHOLINE PHOSPHORYL-CHOLINE] == * smiles: ** C[N+](CCOP([O-])([O-])=O)(C)C * inchi ke...") |
(Created page with "Category:Gene == Gene Ec-17_003950 == * left end position: ** 4172425 * transcription direction: ** NEGATIVE * right end position: ** 4213173 * centisome position: ** 86.9...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-17_003950 == |
− | * | + | * left end position: |
− | ** | + | ** 4172425 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4213173 |
− | * | + | * centisome position: |
− | ** | + | ** 86.962715 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0445_0006 |
− | ** | + | ** Esi0445_0006 |
− | ** | + | ** Possible CDPK |
− | == | + | == Reactions associated == |
− | * [[ | + | * [[PROTEIN-KINASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | * | + | ***ec-number |
− | * | + | == Pathways associated == |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=4172425}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4213173}} | |
− | + | {{#set: centisome position=86.962715 }} | |
− | + | {{#set: common name=Esi_0445_0006|Esi0445_0006|Possible CDPK}} | |
− | + | {{#set: reaction associated=PROTEIN-KINASE-RXN}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 22:50, 17 March 2018
Gene Ec-17_003950
- left end position:
- 4172425
- transcription direction:
- NEGATIVE
- right end position:
- 4213173
- centisome position:
- 86.962715
- Synonym(s):
- Esi_0445_0006
- Esi0445_0006
- Possible CDPK
Reactions associated
- PROTEIN-KINASE-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome