Difference between revisions of "PWY-7053"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] == * smiles: ** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))C...")
 
(Created page with "Category:Gene == Gene Ec-12_007190 == * left end position: ** 6458317 * transcription direction: ** POSITIVE * right end position: ** 6459251 * centisome position: ** 77.4...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CINNAMOYL-COA CINNAMOYL-COA] ==
+
== Gene Ec-12_007190 ==
−
* smiles:
+
* left end position:
−
** CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]
+
** 6458317
−
* inchi key:
+
* transcription direction:
−
** InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J
+
** POSITIVE
−
* common name:
+
* right end position:
−
** (E)-cinnamoyl-CoA
+
** 6459251
−
* molecular weight:
+
* centisome position:
−
** 893.648    
+
** 77.474525    
 
* Synonym(s):
 
* Synonym(s):
−
** trans-cinnamoyl-CoA
+
** Esi_0393_0020
 +
** Esi0393_0020
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-7645]]
+
* [[5.99.1.2-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-2001]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=6458317}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44229143 44229143]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=6459251}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57252 57252]
+
{{#set: centisome position=77.474525   }}
−
* LIGAND-CPD:
+
{{#set: common name=Esi_0393_0020|Esi0393_0020}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C16256 C16256]
+
{{#set: reaction associated=5.99.1.2-RXN}}
−
{{#set: smiles=CC(C)(C(O)C(=O)NCCC(=O)NCCSC(=O)C=CC1(=CC=CC=C1))COP(=O)(OP(=O)(OCC2(C(OP([O-])(=O)[O-])C(O)C(O2)N4(C3(=C(C(N)=NC=N3)N=C4))))[O-])[O-]}}
+
−
{{#set: inchi key=InChIKey=JVNVHNHITFVWIX-KZKUDURGSA-J}}
+
−
{{#set: common name=(E)-cinnamoyl-CoA}}
+
−
{{#set: molecular weight=893.648   }}
+
−
{{#set: common name=trans-cinnamoyl-CoA}}
+
−
{{#set: consumed by=RXN-7645}}
+
−
{{#set: produced by=RXN-2001}}
+

Revision as of 20:30, 17 March 2018

Gene Ec-12_007190

  • left end position:
    • 6458317
  • transcription direction:
    • POSITIVE
  • right end position:
    • 6459251
  • centisome position:
    • 77.474525
  • Synonym(s):
    • Esi_0393_0020
    • Esi0393_0020

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-7053&oldid=9217"