Difference between revisions of "Ec-11 006270"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ALLANTOATE ALLANTOATE] == * smiles: ** C(C(=O)[O-])(NC(=O)N)NC(=O)N * inchi key: ** InChIKey=NU...") |
(Created page with "Category:Gene == Gene Ec-06_005470 == * left end position: ** 4347324 * transcription direction: ** NEGATIVE * right end position: ** 4348532 * centisome position: ** 49.6...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_005470 == |
− | * | + | * left end position: |
− | ** | + | ** 4347324 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4348532 |
− | * | + | * centisome position: |
− | ** | + | ** 49.63969 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0052_0202 |
+ | ** Esi0052_0202 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[ATPASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | * [[ | + | ***go-term |
− | == | + | * [[NUCLEOSIDE-TRIPHOSPHATASE-RXN]] |
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-12195]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN-12196]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[RXN0-5462]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7184]] | ||
+ | * [[PWY-7198]] | ||
+ | * [[PWY-6545]] | ||
+ | * [[PWY-7210]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4347324}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4348532}} | |
− | + | {{#set: centisome position=49.63969 }} | |
− | + | {{#set: common name=Esi_0052_0202|Esi0052_0202}} | |
− | + | {{#set: reaction associated=ATPASE-RXN|NUCLEOSIDE-TRIPHOSPHATASE-RXN|RXN-12195|RXN-12196|RXN0-5462}} | |
− | + | {{#set: pathway associated=PWY-7184|PWY-7198|PWY-6545|PWY-7210}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 21:51, 17 March 2018
Gene Ec-06_005470
- left end position:
- 4347324
- transcription direction:
- NEGATIVE
- right end position:
- 4348532
- centisome position:
- 49.63969
- Synonym(s):
- Esi_0052_0202
- Esi0052_0202
Reactions associated
- ATPASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- NUCLEOSIDE-TRIPHOSPHATASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-12195
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-12196
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN0-5462
- esiliculosus_genome
- go-term
- esiliculosus_genome