Difference between revisions of "DIHYDROOROT-RXN"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9451 CPD-9451] == * smiles: ** CC(C(C(=O)[O-])=CC(=O)[O-])C * inchi key: ** InChIKey=NJMGRJ...") |
(Created page with "Category:Gene == Gene Ec-01_000090 == * Synonym(s): ** Esi_0207_0012 ** Esi0207_0012 == Reactions associated == * DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN ** pantograph...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-01_000090 == |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0207_0012 |
− | ** | + | ** Esi0207_0012 |
− | == | + | == Reactions associated == |
− | + | * [[DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN]] | |
− | == | + | ** [[pantograph]]-[[aragem]] |
− | * [[ | + | * [[H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN]] |
− | * [[ | + | ** [[pantograph]]-[[aragem]] |
+ | == Pathways associated == | ||
+ | * [[PWY-7539]] | ||
+ | * [[PWY-6797]] | ||
+ | * [[PWY-6147]] | ||
== External links == | == External links == | ||
− | + | {{#set: common name=Esi_0207_0012|Esi0207_0012}} | |
− | + | {{#set: reaction associated=DIHYDRONEOPTERIN-MONO-P-DEPHOS-RXN|H2NEOPTERINP3PYROPHOSPHOHYDRO-RXN}} | |
− | + | {{#set: pathway associated=PWY-7539|PWY-6797|PWY-6147}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + |
Revision as of 22:53, 17 March 2018
Gene Ec-01_000090
- Synonym(s):
- Esi_0207_0012
- Esi0207_0012