Difference between revisions of "Ec-18 000810"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ARG-tRNAs ARG-tRNAs] == * common name: ** a tRNAarg * Synonym(s): ** TRNA(ARG) == Reaction(s)...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == * smiles: ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7496 CPD-7496] == |
| + | * smiles: | ||
| + | ** CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C | ||
| + | * inchi key: | ||
| + | ** InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N | ||
* common name: | * common name: | ||
| − | ** | + | ** prolycopene |
| + | * molecular weight: | ||
| + | ** 536.882 | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 7,9,9',7'-tetra-cis-lycopene |
| + | ** 9,9'-di-cis-ζ-carotene | ||
| + | ** 7,9,9',7'-tetracis-lycopene | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
| − | |||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| + | * [[RXN-11357]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| − | * [[ | + | * [[RXN-12242]] |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=10918539 10918539] |
| − | {{#set: | + | * CHEBI: |
| − | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=62466 62466] |
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C15858 C15858] | ||
| + | * HMDB : HMDB35776 | ||
| + | {{#set: smiles=CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C}} | ||
| + | {{#set: inchi key=InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N}} | ||
| + | {{#set: common name=prolycopene}} | ||
| + | {{#set: molecular weight=536.882 }} | ||
| + | {{#set: common name=7,9,9',7'-tetra-cis-lycopene|9,9'-di-cis-ζ-carotene|7,9,9',7'-tetracis-lycopene}} | ||
| + | {{#set: produced by=RXN-11357}} | ||
| + | {{#set: reversible reaction associated=RXN-12242}} | ||
Revision as of 21:54, 17 March 2018
Contents
Metabolite CPD-7496
- smiles:
- CC(=CCCC(=CC=CC(C)=CC=CC(=CC=CC=C(C=CC=C(C)C=CC=C(CCC=C(C)C)C)C)C)C)C
- inchi key:
- InChIKey=OAIJSZIZWZSQBC-BYUNHUQQSA-N
- common name:
- prolycopene
- molecular weight:
- 536.882
- Synonym(s):
- 7,9,9',7'-tetra-cis-lycopene
- 9,9'-di-cis-ζ-carotene
- 7,9,9',7'-tetracis-lycopene
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
