Difference between revisions of "CPD-13376"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=MANNITOL-1P MANNITOL-1P] == * smiles: ** C(C(C(C(C(COP([O-])([O-])=O)O)O)O)O)O * inchi key: **...") |
(Created page with "Category:Gene == Gene Ec-08_002510 == * left end position: ** 2336386 * transcription direction: ** NEGATIVE * right end position: ** 2355144 * centisome position: ** 34.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-08_002510 == |
− | * | + | * left end position: |
− | ** | + | ** 2336386 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 2355144 |
− | * | + | * centisome position: |
− | ** | + | ** 34.886707 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0007_0189 |
+ | ** Esi0007_0189 | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN]] |
− | + | ** esiliculosus_genome | |
− | + | ***go-term | |
− | * [[ | + | * [[RXN-17203]] |
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | == Pathways associated == | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2336386}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=2355144}} | |
− | + | {{#set: centisome position=34.886707 }} | |
− | + | {{#set: common name=Esi_0007_0189|Esi0007_0189}} | |
− | + | {{#set: reaction associated=GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN|RXN-17203}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 21:54, 17 March 2018
Gene Ec-08_002510
- left end position:
- 2336386
- transcription direction:
- NEGATIVE
- right end position:
- 2355144
- centisome position:
- 34.886707
- Synonym(s):
- Esi_0007_0189
- Esi0007_0189
Reactions associated
- GALACTOSYLCERAMIDE-SULFOTRANSFERASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-17203
- esiliculosus_genome
- go-term
- esiliculosus_genome