Difference between revisions of "RXN-8975"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCPDIESTER-RXN GLYCPDIESTER-RXN] == * direction: ** LEFT-TO-RIGHT * common name: ** glycerophosph...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] == * smiles: ** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O * inchi key: ** InCh...")
Line 1: Line 1:
−
[[Category:Reaction]]
+
[[Category:Metabolite]]
−
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=GLYCPDIESTER-RXN GLYCPDIESTER-RXN] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-15895 CPD-15895] ==
−
* direction:
+
* smiles:
−
** LEFT-TO-RIGHT
+
** [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
 +
* inchi key:
 +
** InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
 
* common name:
 
* common name:
−
** glycerophosphodiester phosphodiesterase
+
** keto-D-ribose 5-phosphate
−
* ec number:
+
* molecular weight:
−
** [http://enzyme.expasy.org/EC/3.1.4.46 EC-3.1.4.46]
+
** 228.095   
 
* Synonym(s):
 
* Synonym(s):
  
−
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
−
* With identifiers:
+
== Reaction(s) known to produce the compound ==
−
** 1 [[WATER]][c] '''+''' 1 [[Glycerophosphodiesters]][c] '''=>''' 1 [[PROTON]][c] '''+''' 1 [[GLYCEROL-3P]][c] '''+''' 1 [[Alcohols]][c]
+
* [[RXN-15346]]
−
* With common name(s):
+
* [[RXN-14997]]
−
** 1 H2O[c] '''+''' 1 a glycerophosphodiester[c] '''=>''' 1 H+[c] '''+''' 1 sn-glycerol 3-phosphate[c] '''+''' 1 an alcohol[c]
+
== Reaction(s) of unknown directionality ==
−
 
+
−
== Genes associated with this reaction  ==
+
−
Genes have been associated with this reaction based on different elements listed below.
+
−
* [[Ec-23_002410]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
* [[Ec-23_002720]]
+
−
** ESILICULOSUS_GENOME
+
−
***GO-TERM
+
−
== Pathways  ==
+
−
* [[PWY-6952]], glycerophosphodiester degradation: [http://metacyc.org/META/NEW-IMAGE?object=PWY-6952 PWY-6952]
+
−
** '''2''' reactions found over '''2''' reactions in the full pathway
+
−
== Reconstruction information  ==
+
−
* [[annotation]]:
+
−
** [[pathwaytools]]:
+
−
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
−
* LIGAND-RXN:
+
* PUBCHEM:
−
** [http://www.genome.jp/dbget-bin/www_bget?R00857 R00857]
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=21115541 21115541]
−
* UNIPROT:
+
* CHEBI:
−
** [http://www.uniprot.org/uniprot/Q99387 Q99387]
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58273 58273]
−
** [http://www.uniprot.org/uniprot/P10908 P10908]
+
{{#set: smiles=[CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O}}
−
** [http://www.uniprot.org/uniprot/Q06282 Q06282]
+
{{#set: inchi key=InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L}}
−
** [http://www.uniprot.org/uniprot/Q9V208 Q9V208]
+
{{#set: common name=keto-D-ribose 5-phosphate}}
−
** [http://www.uniprot.org/uniprot/P09394 P09394]
+
{{#set: molecular weight=228.095    }}
−
** [http://www.uniprot.org/uniprot/Q9S3K5 Q9S3K5]
+
{{#set: produced by=RXN-15346|RXN-14997}}
−
{{#set: direction=LEFT-TO-RIGHT}}
+
−
{{#set: common name=glycerophosphodiester phosphodiesterase}}
+
−
{{#set: ec number=EC-3.1.4.46}}
+
−
{{#set: gene associated=Ec-23_002410|Ec-23_002720}}
+
−
{{#set: in pathway=PWY-6952}}
+
−
{{#set: reconstruction category=annotation}}
+
−
{{#set: reconstruction tool=pathwaytools}}
+
−
{{#set: reconstruction source=esiliculosus_genome}}
+

Revision as of 21:54, 17 March 2018

Metabolite CPD-15895

  • smiles:
    • [CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O
  • inchi key:
    • InChIKey=PPQRONHOSHZGFQ-LMVFSUKVSA-L
  • common name:
    • keto-D-ribose 5-phosphate
  • molecular weight:
    • 228.095
  • Synonym(s):

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CH](=O)C(O)C(O)C(COP([O-])([O-])=O)O" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-8975&oldid=14978"