Difference between revisions of "Ec-22 000050"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] == * smiles: ** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23)...")
 
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1581 PWY0-1581] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Pathway]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD1F-136 CPD1F-136] ==
+
== Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY0-1581 PWY0-1581] ==
−
* smiles:
+
* taxonomic range:
−
** C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2 TAX-2]
−
* inchi key:
+
** [http://metacyc.org/META/NEW-IMAGE?object=TAX-2157 TAX-2157]
−
** InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M
+
 
* common name:
 
* common name:
−
** ent-7α-hydroxykaur-16-en-19-oate
+
** nitrate reduction IX (dissimilatory)
−
* molecular weight:
+
−
** 317.447   
+
 
* Synonym(s):
 
* Synonym(s):
−
** ent-7-α-hydroxykaurenoate
+
** glycerol-3-phosphate to nitrate electron transfer
−
** ent-7-α-hydroxykaurenoic acid
+
−
** 7-hydroxy-kaurenoic acid
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction(s) found ==
−
* [[RXN1F-160]]
+
'''1''' reactions found over '''2''' reactions in the full pathway
−
== Reaction(s) known to produce the compound ==
+
* [[RXN-15740]]
−
* [[1.14.13.79-RXN]]
+
** 1 associated gene(s):
−
== Reaction(s) of unknown directionality ==
+
*** [[Ec-10_003310]]
 +
** 1 reconstruction source(s) associated:
 +
*** [[annotation-esiliculosus_genome]]
 +
== Reaction(s) not found ==
 +
* [http://metacyc.org/META/NEW-IMAGE?object=RXN0-3501 RXN0-3501]
 
== External links  ==
 
== External links  ==
−
* LIPID_MAPS : LMPR0104540005
+
* ECOCYC:
−
* PUBCHEM:
+
** [http://metacyc.org/ECOLI/NEW-IMAGE?object=PWY0-1581 PWY0-1581]
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200352 25200352]
+
{{#set: taxonomic range=TAX-2}}
−
* CHEBI:
+
{{#set: taxonomic range=TAX-2157}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57298 57298]
+
{{#set: common name=nitrate reduction IX (dissimilatory)}}
−
* LIGAND-CPD:
+
{{#set: common name=glycerol-3-phosphate to nitrate electron transfer}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C11875 C11875]
+
{{#set: reaction found=1}}
−
{{#set: smiles=C=C1(C4(CC[CH]3(C(C1)(C(O)C[CH]2(C(C([O-])=O)(C)CCCC(C)23))C4)))}}
+
{{#set: total reaction=2}}
−
{{#set: inchi key=InChIKey=KMLXVEXJZSTMBV-YDIYEOSVSA-M}}
+
{{#set: completion rate=50.0}}
−
{{#set: common name=ent-7α-hydroxykaur-16-en-19-oate}}
+
−
{{#set: molecular weight=317.447    }}
+
−
{{#set: common name=ent-7-α-hydroxykaurenoate|ent-7-α-hydroxykaurenoic acid|7-hydroxy-kaurenoic acid}}
+
−
{{#set: consumed by=RXN1F-160}}
+
−
{{#set: produced by=1.14.13.79-RXN}}
+

Revision as of 20:31, 17 March 2018

Pathway PWY0-1581

  • taxonomic range:
  • common name:
    • nitrate reduction IX (dissimilatory)
  • Synonym(s):
    • glycerol-3-phosphate to nitrate electron transfer

Reaction(s) found

1 reactions found over 2 reactions in the full pathway

Reaction(s) not found

External links




Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-22_000050&oldid=9245"