Difference between revisions of "5-HYDROXYINDOLE ACETALDEHYDE"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-474 RXN66-474] == * direction: ** LEFT-TO-RIGHT * common name: ** straight chain (R)-2-hydrox...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] == * smiles: ** CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)C...")
Line 1: Line 1:
[[Category:Reaction]]
+
[[Category:Metabolite]]
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN66-474 RXN66-474] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17328 CPD-17328] ==
* direction:
+
* smiles:
** LEFT-TO-RIGHT
+
** CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
 +
* inchi key:
 +
** InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J
 
* common name:
 
* common name:
** straight chain (R)-2-hydroxy fatty acyl-CoA ligase
+
** (9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA
* ec number:
+
* molecular weight:
** [http://enzyme.expasy.org/EC/6.2.1 EC-6.2.1]
+
** 1106.066   
 
* Synonym(s):
 
* Synonym(s):
 +
** (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA
  
== Reaction Formula ==
+
== Reaction(s) known to consume the compound ==
* With identifiers:
+
* [[RXN-17112]]
** 1 [[R2OH-Straight-Chain-234-Sat-FA]][c] '''+''' 1 [[ATP]][c] '''+''' 1 [[CO-A]][c] '''=>''' 1 [[PPI]][c] '''+''' 1 [[AMP]][c] '''+''' 1 [[R2-2OH-Straight-Chain-234-Sat-FA-CoA]][c]
+
== Reaction(s) known to produce the compound ==
* With common name(s):
+
* [[RXN-17111]]
** 1 a (2R)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acid[c] '''+''' 1 ATP[c] '''+''' 1 coenzyme A[c] '''=>''' 1 diphosphate[c] '''+''' 1 AMP[c] '''+''' 1 a (R)-2-hydroxy even numbered straight chain 2,3,4-saturated fatty acyl CoA[c]
+
== Reaction(s) of unknown directionality ==
 
+
== Genes associated with this reaction  ==
+
== Pathways  ==
+
* [[PWY66-388]], fatty acid α-oxidation III: [http://metacyc.org/META/NEW-IMAGE?object=PWY66-388 PWY66-388]
+
** '''4''' reactions found over '''7''' reactions in the full pathway
+
== Reconstruction information  ==
+
* [[annotation]]:
+
** [[pathwaytools]]:
+
*** [[esiliculosus_genome]]
+
 
== External links  ==
 
== External links  ==
{{#set: direction=LEFT-TO-RIGHT}}
+
* PUBCHEM:
{{#set: common name=straight chain (R)-2-hydroxy fatty acyl-CoA ligase}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71581220 71581220]
{{#set: ec number=EC-6.2.1}}
+
* CHEBI:
{{#set: in pathway=PWY66-388}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=74087 74087]
{{#set: reconstruction category=annotation}}
+
{{#set: smiles=CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O}}
{{#set: reconstruction tool=pathwaytools}}
+
{{#set: inchi key=InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J}}
{{#set: reconstruction source=esiliculosus_genome}}
+
{{#set: common name=(9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA}}
 +
{{#set: molecular weight=1106.066    }}
 +
{{#set: common name=(9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA}}
 +
{{#set: consumed by=RXN-17112}}
 +
{{#set: produced by=RXN-17111}}

Revision as of 21:55, 17 March 2018

Metabolite CPD-17328

  • smiles:
    • CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O
  • inchi key:
    • InChIKey=OKOXEYTYHDPTEW-GJYKHRJNSA-J
  • common name:
    • (9Z,12Z,15Z,18Z)-tetracosatetraenoyl-CoA
  • molecular weight:
    • 1106.066
  • Synonym(s):
    • (9Z,12Z,15Z,18Z)-tetracosa-9,12,15,18-tetraenoyl-CoA

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

"CCCCCC=CCC=CCC=CCC=CCCCCCCCC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O" cannot be used as a page name in this wiki.