Difference between revisions of "RXN-14789"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-182 CPD-182] == * smiles: ** CC1(=CC(OC2(C=C(O)C=CC1=2))=O) * inchi key: ** InChIKey=HSHNIT...") |
(Created page with "Category:Gene == Gene Ec-23_002330 == * left end position: ** 2462540 * transcription direction: ** POSITIVE * right end position: ** 2477190 * centisome position: ** 50.8...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-23_002330 == |
− | * | + | * left end position: |
− | ** | + | ** 2462540 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 2477190 |
− | * | + | * centisome position: |
− | ** | + | ** 50.884525 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0132_0081 |
+ | ** Esi0132_0081 | ||
− | == | + | == Reactions associated == |
− | + | * [[RXN-12086]] | |
− | * [[RXN- | + | ** esiliculosus_genome |
− | == | + | ***go-term |
+ | * [[RXN-12579]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | * [[TRIACYLGLYCEROL-LIPASE-RXN]] | ||
+ | ** esiliculosus_genome | ||
+ | ***go-term | ||
+ | == Pathways associated == | ||
+ | * [[LIPAS-PWY]] | ||
+ | * [[PWY-6857]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=2462540}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=2477190}} | |
− | + | {{#set: centisome position=50.884525 }} | |
− | + | {{#set: common name=Esi_0132_0081|Esi0132_0081}} | |
− | + | {{#set: reaction associated=RXN-12086|RXN-12579|TRIACYLGLYCEROL-LIPASE-RXN}} | |
− | + | {{#set: pathway associated=LIPAS-PWY|PWY-6857}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + |
Revision as of 21:55, 17 March 2018
Gene Ec-23_002330
- left end position:
- 2462540
- transcription direction:
- POSITIVE
- right end position:
- 2477190
- centisome position:
- 50.884525
- Synonym(s):
- Esi_0132_0081
- Esi0132_0081
Reactions associated
- RXN-12086
- esiliculosus_genome
- go-term
- esiliculosus_genome
- RXN-12579
- esiliculosus_genome
- go-term
- esiliculosus_genome
- TRIACYLGLYCEROL-LIPASE-RXN
- esiliculosus_genome
- go-term
- esiliculosus_genome