Difference between revisions of "Ec-15 002870"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] == * smiles: ** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O...")
 
(Created page with "Category:Gene == Gene Ec-14_000990 == * left end position: ** 983925 * transcription direction: ** POSITIVE * right end position: ** 986715 * centisome position: ** 14.997...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-7064 CPD-7064] ==
+
== Gene Ec-14_000990 ==
−
* smiles:
+
* left end position:
−
** CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)
+
** 983925
−
* inchi key:
+
* transcription direction:
−
** InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M
+
** POSITIVE
−
* common name:
+
* right end position:
−
** primary fluorescent chlorophyll catabolite
+
** 986715
−
* molecular weight:
+
* centisome position:
−
** 626.708    
+
** 14.997879    
 
* Synonym(s):
 
* Synonym(s):
−
** pFCC
+
** Esi_0256_0044
−
** (82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione
+
** Esi0256_0044
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
== Reaction(s) known to produce the compound ==
+
* [[PROTEIN-KINASE-RXN]]
−
* [[RXN-7741]]
+
** esiliculosus_genome
−
== Reaction(s) of unknown directionality ==
+
***go-term
 +
== Pathways associated ==
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=983925}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=91819909 91819909]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=986715}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58719 58719]
+
{{#set: centisome position=14.997879   }}
−
{{#set: smiles=CCC1(C(C)=C(NC=1CC4(=C(C)C5(C(=O)[C-](C(OC)=O)C(=C2(C(CCC(=O)[O-])C(C)C(=N2)CC3(C(C)=C(C=C)C(=O)N3)))C(N4)=5)))C=O)}}
+
{{#set: common name=Esi_0256_0044|Esi0256_0044}}
−
{{#set: inchi key=InChIKey=VHQSFNUIHPNTMW-LRYVNUGJSA-M}}
+
{{#set: reaction associated=PROTEIN-KINASE-RXN}}
−
{{#set: common name=primary fluorescent chlorophyll catabolite}}
+
−
{{#set: molecular weight=626.708   }}
+
−
{{#set: common name=pFCC|(82R,12S,13S)-12-(2-carboxyethyl)-3-ethyl-1-formyl-82-(methoxycarbonyl)-2,7,13,17-tetramethyl-18-vinyl-12,13-dihydro-8,10-ethanobilene-b-81,19(16H)-dione}}
+
−
{{#set: produced by=RXN-7741}}
+

Revision as of 21:56, 17 March 2018

Gene Ec-14_000990

  • left end position:
    • 983925
  • transcription direction:
    • POSITIVE
  • right end position:
    • 986715
  • centisome position:
    • 14.997879
  • Synonym(s):
    • Esi_0256_0044
    • Esi0256_0044

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-15_002870&oldid=15129"