Difference between revisions of "3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] == * smiles: ** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-]...")
 
(Created page with "Category:Gene == Gene Ec-25_000910 == * left end position: ** 1105393 * transcription direction: ** POSITIVE * right end position: ** 1105722 * centisome position: ** 24.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-9007 CPD-9007] ==
+
== Gene Ec-25_000910 ==
−
* smiles:
+
* left end position:
−
** C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O
+
** 1105393
−
* inchi key:
+
* transcription direction:
−
** InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K
+
** POSITIVE
−
* common name:
+
* right end position:
−
** ADP ribose 1'',2''-cyclic phosphate
+
** 1105722
−
* molecular weight:
+
* centisome position:
−
** 618.26    
+
** 24.835058    
 
* Synonym(s):
 
* Synonym(s):
−
** ADP ribose 1''-2''-cyclic phosphate
+
** Esi_0232_0034
−
** ADP ribose 1'',2''-phosphate
+
** Esi0232_0034
−
** adenosine diphosphate ribose 1'',2''-cyclic phosphate
+
−
** Appr>p
+
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-12055]]
+
* [[UBIQUITIN--PROTEIN-LIGASE-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[2.7.1.160-RXN]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-7511]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=1105393}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25245989 25245989]
+
{{#set: transcription direction=POSITIVE}}
−
* CHEBI:
+
{{#set: right end position=1105722}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=76596 76596]
+
{{#set: centisome position=24.835058   }}
−
{{#set: smiles=C(C3(C(C(C(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O)O))OP(OP(=O)([O-])OCC4(C(O)C5(OP(=O)([O-])OC(O4)5)))([O-])=O}}
+
{{#set: common name=Esi_0232_0034|Esi0232_0034}}
−
{{#set: inchi key=InChIKey=NPSPRYXPOGPCPM-TYASJMOZSA-K}}
+
{{#set: reaction associated=UBIQUITIN--PROTEIN-LIGASE-RXN}}
−
{{#set: common name=ADP ribose 1'',2''-cyclic phosphate}}
+
{{#set: pathway associated=PWY-7511}}
−
{{#set: molecular weight=618.26   }}
+
−
{{#set: common name=ADP ribose 1''-2''-cyclic phosphate|ADP ribose 1'',2''-phosphate|adenosine diphosphate ribose 1'',2''-cyclic phosphate|Appr>p}}
+
−
{{#set: consumed by=RXN-12055}}
+
−
{{#set: produced by=2.7.1.160-RXN}}
+

Revision as of 21:56, 17 March 2018

Gene Ec-25_000910

  • left end position:
    • 1105393
  • transcription direction:
    • POSITIVE
  • right end position:
    • 1105722
  • centisome position:
    • 24.835058
  • Synonym(s):
    • Esi_0232_0034
    • Esi0232_0034

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=3-HYDROXYISOBUTYRATE-DEHYDROGENASE-RXN&oldid=15134"