Difference between revisions of "RXN-10705"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Gene == Gene Ec-08_003590 == * left end position: ** 3421394 * transcription direction: ** NEGATIVE * right end position: ** 3424363 * centisome position: ** 51.0...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] == * smiles: ** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-] * inchi key: ** InChI...")
Line 1: Line 1:
−
[[Category:Gene]]
+
[[Category:Metabolite]]
−
== Gene Ec-08_003590 ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-10244 CPD-10244] ==
−
* left end position:
+
* smiles:
−
** 3421394
+
** CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]
−
* transcription direction:
+
* inchi key:
−
** NEGATIVE
+
** InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M
−
* right end position:
+
* common name:
−
** 3424363
+
** docosahexaenoate
−
* centisome position:
+
* molecular weight:
−
** 51.08795    
+
** 327.486    
 
* Synonym(s):
 
* Synonym(s):
−
** Esi_0342_0001
+
** docosahexaenoic acid
−
** Esi0342_0001
+
** DHA
−
** Fe/MnSOD
+
** all-cis-docosa-4,7,10,13,16,19-hexaenoate
 +
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
 +
** (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate
  
−
== Reactions associated ==
+
== Reaction(s) known to consume the compound ==
−
* [[SUPEROX-DISMUT-RXN]]
+
== Reaction(s) known to produce the compound ==
−
** esiliculosus_genome
+
* [[RXN-16138]]
−
***ec-number
+
== Reaction(s) of unknown directionality ==
−
== Pathways associated ==
+
−
* [[DETOX1-PWY-1]]
+
−
* [[PWY-6854]]
+
−
* [[DETOX1-PWY]]
+
 
== External links  ==
 
== External links  ==
−
{{#set: left end position=3421394}}
+
* LIPID_MAPS : LMFA01030185
−
{{#set: transcription direction=NEGATIVE}}
+
* PUBCHEM:
−
{{#set: right end position=3424363}}
+
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=40486925 40486925]
−
{{#set: centisome position=51.08795   }}
+
* DRUGBANK : DB03756
−
{{#set: common name=Esi_0342_0001|Esi0342_0001|Fe/MnSOD}}
+
* CHEBI:
−
{{#set: reaction associated=SUPEROX-DISMUT-RXN}}
+
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=77016 77016]
−
{{#set: pathway associated=DETOX1-PWY-1|PWY-6854|DETOX1-PWY}}
+
* HMDB : HMDB02183
 +
{{#set: smiles=CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]}}
 +
{{#set: inchi key=InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M}}
 +
{{#set: common name=docosahexaenoate}}
 +
{{#set: molecular weight=327.486   }}
 +
{{#set: common name=docosahexaenoic acid|DHA|all-cis-docosa-4,7,10,13,16,19-hexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate|(4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate}}
 +
{{#set: produced by=RXN-16138}}

Revision as of 21:56, 17 March 2018

Metabolite CPD-10244

  • smiles:
    • CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-]
  • inchi key:
    • InChIKey=MBMBGCFOFBJSGT-KUBAVDMBSA-M
  • common name:
    • docosahexaenoate
  • molecular weight:
    • 327.486
  • Synonym(s):
    • docosahexaenoic acid
    • DHA
    • all-cis-docosa-4,7,10,13,16,19-hexaenoate
    • (4Z,7Z,10Z,13Z,16Z,19Z)-docosahexaenoate
    • (4Z,7Z,10Z,13Z,16Z,19Z)-docosa-4,7,10,13,16,19-hexaenoate

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

  • LIPID_MAPS : LMFA01030185
  • PUBCHEM:
  • DRUGBANK : DB03756
  • CHEBI:
  • HMDB : HMDB02183
"CCC=CCC=CCC=CCC=CCC=CCC=CCCC(=O)[O-" cannot be used as a page name in this wiki.



Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=RXN-10705&oldid=15136"