Difference between revisions of "GLY-tRNAs"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-14766 CPD-14766] == * smiles: ** CCCCCCCCCCCCCCC(O)[CH]=O * inchi key: ** InChIKey=BKBDVQVD...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENYLOSUCC ADENYLOSUCC] == * smiles: ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=NC=NC=2...") |
||
| Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
| − | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADENYLOSUCC ADENYLOSUCC] == |
* smiles: | * smiles: | ||
| − | ** | + | ** C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=NC=NC=23)NC(CC(=O)[O-])C(=O)[O-]))) |
* inchi key: | * inchi key: | ||
| − | ** InChIKey= | + | ** InChIKey=OFBHPPMPBOJXRT-DPXQIYNJSA-J |
* common name: | * common name: | ||
| − | ** | + | ** adenylo-succinate |
* molecular weight: | * molecular weight: | ||
| − | ** | + | ** 459.265 |
* Synonym(s): | * Synonym(s): | ||
| + | ** N6-(1,2-dicarboxyethyl)-AMP | ||
| + | ** adenylo-succ | ||
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
| − | * [[ | + | * [[ADENYLOSUCCINATE-SYNTHASE-RXN]] |
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
| + | * [[AMPSYN-RXN]] | ||
== External links == | == External links == | ||
| + | * CAS : 19240-42-7 | ||
| + | * BIGG : 42544 | ||
* PUBCHEM: | * PUBCHEM: | ||
| − | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46878398 46878398] |
| + | * HMDB : HMDB00536 | ||
| + | * LIGAND-CPD: | ||
| + | ** [http://www.genome.jp/dbget-bin/www_bget?C03794 C03794] | ||
* CHEBI: | * CHEBI: | ||
| − | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId= | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57567 57567] |
| − | {{#set: smiles= | + | * METABOLIGHTS : MTBLC57567 |
| − | {{#set: inchi key=InChIKey= | + | {{#set: smiles=C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=NC=NC=23)NC(CC(=O)[O-])C(=O)[O-])))}} |
| − | {{#set: common name= | + | {{#set: inchi key=InChIKey=OFBHPPMPBOJXRT-DPXQIYNJSA-J}} |
| − | {{#set: molecular weight= | + | {{#set: common name=adenylo-succinate}} |
| − | {{#set: produced by=RXN- | + | {{#set: molecular weight=459.265 }} |
| + | {{#set: common name=N6-(1,2-dicarboxyethyl)-AMP|adenylo-succ}} | ||
| + | {{#set: produced by=ADENYLOSUCCINATE-SYNTHASE-RXN}} | ||
| + | {{#set: reversible reaction associated=AMPSYN-RXN}} | ||
Revision as of 21:57, 17 March 2018
Contents
Metabolite ADENYLOSUCC
- smiles:
- C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=NC=NC=23)NC(CC(=O)[O-])C(=O)[O-])))
- inchi key:
- InChIKey=OFBHPPMPBOJXRT-DPXQIYNJSA-J
- common name:
- adenylo-succinate
- molecular weight:
- 459.265
- Synonym(s):
- N6-(1,2-dicarboxyethyl)-AMP
- adenylo-succ
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 19240-42-7
- BIGG : 42544
- PUBCHEM:
- HMDB : HMDB00536
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57567
"C(OP(=O)([O-])[O-])C1(OC(C(O)C(O)1)N3(C=NC2(C(=NC=NC=23)NC(CC(=O)[O-])C(=O)[O-])))" cannot be used as a page name in this wiki.
