Difference between revisions of "RXN-14024"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD3DJ-82 CPD3DJ-82] == * common name: ** a dihydroceramide * Synonym(s): ** a plant ceramide (...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTYL-PYROPHOSPHATE PHYTYL-PYROPHOSPHATE] == * smiles: ** CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP(...") |
||
Line 1: | Line 1: | ||
[[Category:Metabolite]] | [[Category:Metabolite]] | ||
− | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object= | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=PHYTYL-PYROPHOSPHATE PHYTYL-PYROPHOSPHATE] == |
+ | * smiles: | ||
+ | ** CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C | ||
+ | * inchi key: | ||
+ | ** InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K | ||
* common name: | * common name: | ||
− | ** | + | ** phytyl diphosphate |
+ | * molecular weight: | ||
+ | ** 453.471 | ||
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** phytyl pyrophosphate |
− | ** | + | ** phytyl-PP |
== Reaction(s) known to consume the compound == | == Reaction(s) known to consume the compound == | ||
+ | * [[RXN-2541]] | ||
== Reaction(s) known to produce the compound == | == Reaction(s) known to produce the compound == | ||
+ | * [[RXN-7660]] | ||
+ | * [[RXN-10625]] | ||
== Reaction(s) of unknown directionality == | == Reaction(s) of unknown directionality == | ||
− | |||
== External links == | == External links == | ||
− | {{#set: common name= | + | * PUBCHEM: |
− | {{#set: common name= | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=71728454 71728454] |
− | {{#set: consumed | + | * CHEBI: |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=75434 75434] | ||
+ | * LIGAND-CPD: | ||
+ | ** [http://www.genome.jp/dbget-bin/www_bget?C05427 C05427] | ||
+ | {{#set: smiles=CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C}} | ||
+ | {{#set: inchi key=InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K}} | ||
+ | {{#set: common name=phytyl diphosphate}} | ||
+ | {{#set: molecular weight=453.471 }} | ||
+ | {{#set: common name=phytyl pyrophosphate|phytyl-PP}} | ||
+ | {{#set: consumed by=RXN-2541}} | ||
+ | {{#set: produced by=RXN-7660|RXN-10625}} |
Revision as of 21:57, 17 March 2018
Contents
Metabolite PHYTYL-PYROPHOSPHATE
- smiles:
- CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C
- inchi key:
- InChIKey=ITPLBNCCPZSWEU-PYDDKJGSSA-K
- common name:
- phytyl diphosphate
- molecular weight:
- 453.471
- Synonym(s):
- phytyl pyrophosphate
- phytyl-PP
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(CCCC(CCCC(CCCC(=CCOP([O-])(=O)OP([O-])(=O)[O-])C)C)C)C" cannot be used as a page name in this wiki.