Difference between revisions of "PWY-6313"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] == * smiles: ** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(...")
 
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14213 RXN-14213] == * direction: ** REVERSIBLE * common name: ** Apyrase * ec number: ** [http:...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Reaction]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=FAD FAD] ==
+
== Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-14213 RXN-14213] ==
−
* smiles:
+
* direction:
−
** CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))
+
** REVERSIBLE
−
* inchi key:
+
−
** InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K
+
 
* common name:
 
* common name:
−
** FAD
+
** Apyrase
−
* molecular weight:
+
* ec number:
−
** 782.533   
+
** [http://enzyme.expasy.org/EC/3.6.1 EC-3.6.1]
 
* Synonym(s):
 
* Synonym(s):
−
** flavin adenine dinucleotide oxidized
 
−
** flavin adenine dinucleotide
 
−
** flavitan
 
  
−
== Reaction(s) known to consume the compound ==
+
== Reaction Formula ==
−
* [[MEPROPCOA-FAD-RXN]]
+
* With identifiers:
−
== Reaction(s) known to produce the compound ==
+
** 1 [[TDP]][c] '''+''' 1 [[WATER]][c] '''<=>''' 1 [[PROTON]][c] '''+''' 1 [[Pi]][c] '''+''' 1 [[TMP]][c]
−
* [[FADSYN-RXN]]
+
* With common name(s):
−
== Reaction(s) of unknown directionality ==
+
** 1 dTDP[c] '''+''' 1 H2O[c] '''<=>''' 1 H+[c] '''+''' 1 phosphate[c] '''+''' 1 dTMP[c]
−
* [[RXN-14264]]
+
 
 +
== Genes associated with this reaction  ==
 +
Genes have been associated with this reaction based on different elements listed below.
 +
* [[Ec-02_001970]]
 +
** ESILICULOSUS_GENOME
 +
***AUTOMATED-NAME-MATCH
 +
== Pathways  ==
 +
== Reconstruction information  ==
 +
* Category: [[annotation]]
 +
** Source: [[annotation-esiliculosus_genome]]
 +
*** Tool: [[pathwaytools]]
 
== External links  ==
 
== External links  ==
−
* CAS : 146-14-5
+
{{#set: direction=REVERSIBLE}}
−
* Wikipedia : Flavin_adenine_dinucleotide
+
{{#set: common name=Apyrase}}
−
* PUBCHEM:
+
{{#set: ec number=EC-3.6.1}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=46906035 46906035]
+
{{#set: gene associated=Ec-02_001970}}
−
* HMDB : HMDB01248
+
{{#set: in pathway=}}
−
* LIGAND-CPD:
+
{{#set: reconstruction category=annotation}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C00016 C00016]
+
{{#set: reconstruction source=annotation-esiliculosus_genome}}
−
* CHEMSPIDER:
+
{{#set: reconstruction tool=pathwaytools}}
−
** [http://www.chemspider.com/Chemical-Structure.13082029.html 13082029]
+
−
* CHEBI:
+
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57692 57692]
+
−
* BIGG : 33521
+
−
{{#set: smiles=CC6(=C(C)C=C5(C(N=C1(C(=O)[N-]C(=O)N=C1N(CC(C(O)C(O)COP(OP([O-])(OCC4(C(O)C(O)C(N3(C=NC2(C(N)=NC=NC=23)))O4))=O)([O-])=O)O)5))=C6))}}
+
−
{{#set: inchi key=InChIKey=IMGVNJNCCGXBHD-UYBVJOGSSA-K}}
+
−
{{#set: common name=FAD}}
+
−
{{#set: molecular weight=782.533    }}
+
−
{{#set: common name=flavin adenine dinucleotide oxidized|flavin adenine dinucleotide|flavitan}}
+
−
{{#set: consumed by=MEPROPCOA-FAD-RXN}}
+
−
{{#set: produced by=FADSYN-RXN}}
+
−
{{#set: consumed or produced by=RXN-14264}}
+

Revision as of 20:31, 17 March 2018

Reaction RXN-14213

  • direction:
    • REVERSIBLE
  • common name:
    • Apyrase
  • ec number:
  • Synonym(s):

Reaction Formula

  • With identifiers:
  • With common name(s):
    • 1 dTDP[c] + 1 H2O[c] <=> 1 H+[c] + 1 phosphate[c] + 1 dTMP[c]

Genes associated with this reaction

Genes have been associated with this reaction based on different elements listed below.

Pathways

Reconstruction information

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=PWY-6313&oldid=9262"