Difference between revisions of "CPD-9965"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] == * smiles: ** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)C...")
 
(Created page with "Category:Gene == Gene Ec-12_002540 == * left end position: ** 2268699 * transcription direction: ** POSITIVE * right end position: ** 2278769 * centisome position: ** 27.2...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-17046 CPD-17046] ==
+
== Gene Ec-12_002540 ==
−
* smiles:
+
* left end position:
−
** C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O
+
** 2268699
−
* inchi key:
+
* transcription direction:
−
** InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L
+
** POSITIVE
−
* common name:
+
* right end position:
−
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine
+
** 2278769
−
* molecular weight:
+
* centisome position:
−
** 842.848    
+
** 27.215511    
 
* Synonym(s):
 
* Synonym(s):
−
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP
+
** Esi_0216_0030
−
** 3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione
+
** Esi0216_0030
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-15681]]
+
* [[6PFRUCTPHOS-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-15680]]
+
***go-term
−
== Reaction(s) of unknown directionality ==
+
** [[pantograph]]-[[aragem]]
 +
** [[pantograph]]-[[aragem]]
 +
== Pathways associated ==
 +
* [[PWY-1042]]
 +
* [[GLYCOLYSIS]]
 +
* [[PWY-7385]]
 +
* [[PWY-1861]]
 +
* [[ANAGLYCOLYSIS-PWY]]
 +
* [[PWY-5484]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=2268699}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=90657797 90657797]
+
{{#set: transcription direction=POSITIVE}}
−
{{#set: smiles=C(SC2(CC1(=CC=CC=C1))(NC(=O)C(SCC(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O)(CO)NC(=O)2))C(C(NCC([O-])=O)=O)NC(=O)CCC([N+])C([O-])=O}}
+
{{#set: right end position=2278769}}
−
{{#set: inchi key=InChIKey=YJISLDWVIYDIOE-WGTGPSAHSA-L}}
+
{{#set: centisome position=27.215511   }}
−
{{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-diketopiperazine}}
+
{{#set: common name=Esi_0216_0030|Esi0216_0030}}
−
{{#set: molecular weight=842.848   }}
+
{{#set: reaction associated=6PFRUCTPHOS-RXN}}
−
{{#set: common name=3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)-DKP|3-benzyl-3,6 -bis(glutathione)- 6-(hydroxymethyl)piperazine-2,5-dione}}
+
{{#set: pathway associated=PWY-1042|GLYCOLYSIS|PWY-7385|PWY-1861|ANAGLYCOLYSIS-PWY|PWY-5484}}
−
{{#set: consumed by=RXN-15681}}
+
−
{{#set: produced by=RXN-15680}}
+

Revision as of 21:59, 17 March 2018

Gene Ec-12_002540

  • left end position:
    • 2268699
  • transcription direction:
    • POSITIVE
  • right end position:
    • 2278769
  • centisome position:
    • 27.215511
  • Synonym(s):
    • Esi_0216_0030
    • Esi0216_0030

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=CPD-9965&oldid=15292"