Difference between revisions of "2.7.7.15-RXN"
From metabolic_network
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-7644 RXN-7644] == * direction: ** REVERSIBLE * common name: ** D-sorbitol 2-dehydrogenase ** Gr...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] == * smiles: ** C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ADP-D-GLUCOSE ADP-D-GLUCOSE] == |
− | * | + | * smiles: |
− | ** | + | ** C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C(N)C(N=C3)=4))))(=O)[O-])(=O)[O-])O)O)O))O |
+ | * inchi key: | ||
+ | ** InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L | ||
* common name: | * common name: | ||
− | ** | + | ** ADP-α-D-glucose |
− | + | * molecular weight: | |
− | * | + | ** 587.33 |
− | ** | + | |
* Synonym(s): | * Synonym(s): | ||
+ | ** adenosine diphosphate glucose | ||
+ | ** ADP-glucose | ||
+ | ** ADP-D-glucose | ||
− | == Reaction | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-761]] | |
− | + | ||
− | + | ||
− | = | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | * | + | * CAS : 2140-58-1 |
− | ** [http:// | + | * BIGG : 35161 |
− | * LIGAND- | + | * PUBCHEM: |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=42609821 42609821] |
− | + | * HMDB : HMDB06557 | |
− | + | * LIGAND-CPD: | |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00498 C00498] |
− | + | * CHEBI: | |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57498 57498] |
− | {{#set: | + | * METABOLIGHTS : MTBLC57498 |
− | {{#set: | + | {{#set: smiles=C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C(N)C(N=C3)=4))))(=O)[O-])(=O)[O-])O)O)O))O}} |
− | {{#set: | + | {{#set: inchi key=InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L}} |
− | {{#set: | + | {{#set: common name=ADP-α-D-glucose}} |
+ | {{#set: molecular weight=587.33 }} | ||
+ | {{#set: common name=adenosine diphosphate glucose|ADP-glucose|ADP-D-glucose}} | ||
+ | {{#set: reversible reaction associated=RXN-761}} |
Revision as of 22:59, 17 March 2018
Contents
Metabolite ADP-D-GLUCOSE
- smiles:
- C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C(N)C(N=C3)=4))))(=O)[O-])(=O)[O-])O)O)O))O
- inchi key:
- InChIKey=WFPZSXYXPSUOPY-ROYWQJLOSA-L
- common name:
- ADP-α-D-glucose
- molecular weight:
- 587.33
- Synonym(s):
- adenosine diphosphate glucose
- ADP-glucose
- ADP-D-glucose
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 2140-58-1
- BIGG : 35161
- PUBCHEM:
- HMDB : HMDB06557
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57498
"C(C1(C(C(C(C(O1)OP(OP(OCC2(OC(C(C2O)O)N3(C4(N=CN=C(N)C(N=C3)=4))))(=O)[O-])(=O)[O-])O)O)O))O" cannot be used as a page name in this wiki.