Difference between revisions of "Ec-24 002610"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-03_002180 == * left end position: ** 2663850 * transcription direction: ** POSITIVE * right end position: ** 2672990 * centisome position: ** 40.8...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-466 CPD-466] == * smiles: ** CC(C[N+])C([O-])=O * inchi key: ** InChIKey=QCHPKSFMDHPSNR-VKH...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-466 CPD-466] == |
− | * | + | * smiles: |
− | ** | + | ** CC(C[N+])C([O-])=O |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=QCHPKSFMDHPSNR-VKHMYHEASA-N |
− | * | + | * common name: |
− | ** | + | ** (S)-3-amino-2-methylpropanoate |
− | * | + | * molecular weight: |
− | ** | + | ** 103.121 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** L-3-amino-isobutanoate |
− | ** | + | ** (S)-3-amino-isobutyric acid |
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[2.6.1.22-RXN]] | |
− | == | + | |
− | * [[ | + | |
− | + | ||
− | + | ||
− | + | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C03284 C03284] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58655 58655] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC58655 |
− | {{#set: reaction associated= | + | * PUBCHEM: |
− | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=6971062 6971062] | |
+ | * HMDB : HMDB02166 | ||
+ | {{#set: smiles=CC(C[N+])C([O-])=O}} | ||
+ | {{#set: inchi key=InChIKey=QCHPKSFMDHPSNR-VKHMYHEASA-N}} | ||
+ | {{#set: common name=(S)-3-amino-2-methylpropanoate}} | ||
+ | {{#set: molecular weight=103.121 }} | ||
+ | {{#set: common name=L-3-amino-isobutanoate|(S)-3-amino-isobutyric acid}} | ||
+ | {{#set: reversible reaction associated=2.6.1.22-RXN}} |
Revision as of 22:00, 17 March 2018
Contents
Metabolite CPD-466
- smiles:
- CC(C[N+])C([O-])=O
- inchi key:
- InChIKey=QCHPKSFMDHPSNR-VKHMYHEASA-N
- common name:
- (S)-3-amino-2-methylpropanoate
- molecular weight:
- 103.121
- Synonym(s):
- L-3-amino-isobutanoate
- (S)-3-amino-isobutyric acid
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C[N+])C([O-])=O" cannot be used as a page name in this wiki.