Difference between revisions of "RXN-14160"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=2K-ADIPATE 2K-ADIPATE] == * smiles: ** C(CC(=O)C(=O)[O-])CC(=O)[O-] * inchi key: ** InChIKey=FG...") |
(Created page with "Category:Pathway == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410] == * taxonomic range: ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-31...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Pathway]] |
| − | == | + | == Pathway [http://metacyc.org/META/NEW-IMAGE?object=PWY-5410 PWY-5410] == |
| − | * | + | * taxonomic range: |
| − | ** | + | ** [http://metacyc.org/META/NEW-IMAGE?object=TAX-3193 TAX-3193] |
| − | + | ||
| − | + | ||
* common name: | * common name: | ||
| − | ** | + | ** traumatin and (Z)-3-hexen-1-yl acetate biosynthesis |
| − | + | ||
| − | + | ||
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 13-lipoxygenase and 13-hydroperoxide lyase pathway |
| − | + | ** 13-LOX and 13-HPL pathway | |
| − | ** | + | |
| − | + | ||
| − | == Reaction(s) | + | == Reaction(s) found == |
| − | * [[ | + | '''1''' reactions found over '''9''' reactions in the full pathway |
| − | == Reaction(s) | + | * [[RXN-1321]] |
| − | == | + | ** 4 associated gene(s): |
| − | * [[ | + | *** [[Ec-20_003620]] |
| + | *** [[Ec-03_000020]] | ||
| + | *** [[Ec-03_000010]] | ||
| + | *** [[Ec-20_003630]] | ||
| + | ** 2 reconstruction source(s) associated: | ||
| + | *** [[annotation-esiliculosus_genome]] | ||
| + | *** [[orthology-aragem]] | ||
| + | == Reaction(s) not found == | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=HYDROHEX-RXN HYDROHEX-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=LIPOXYGENASE-RXN LIPOXYGENASE-RXN] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-11852 RXN-11852] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-12299 RXN-12299] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1345 RXN-1345] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1346 RXN-1346] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1347 RXN-1347] | ||
| + | * [http://metacyc.org/META/NEW-IMAGE?object=RXN-1349 RXN-1349] | ||
== External links == | == External links == | ||
| − | * | + | * ARACYC: |
| − | + | ** [http://metacyc.org/ARA/NEW-IMAGE?object=PWY-5410 PWY-5410] | |
| − | ** [http:// | + | {{#set: taxonomic range=TAX-3193}} |
| − | + | {{#set: common name=traumatin and (Z)-3-hexen-1-yl acetate biosynthesis}} | |
| − | + | {{#set: common name=13-lipoxygenase and 13-hydroperoxide lyase pathway|13-LOX and 13-HPL pathway}} | |
| − | + | {{#set: reaction found=1}} | |
| − | + | {{#set: total reaction=9}} | |
| − | + | {{#set: completion rate=11.0}} | |
| − | + | ||
| − | + | ||
| − | + | ||
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: common name= | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | {{#set: | + | |
| − | + | ||
Revision as of 20:31, 17 March 2018
Pathway PWY-5410
- taxonomic range:
- common name:
- traumatin and (Z)-3-hexen-1-yl acetate biosynthesis
- Synonym(s):
- 13-lipoxygenase and 13-hydroperoxide lyase pathway
- 13-LOX and 13-HPL pathway
Reaction(s) found
1 reactions found over 9 reactions in the full pathway
- RXN-1321
- 4 associated gene(s):
- 2 reconstruction source(s) associated:
Reaction(s) not found
External links
- ARACYC:
