Difference between revisions of "Ec-28 001180"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THMPT THMPT] == * smiles: ** CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C...")
 
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Light Light] == * common name: ** hν * Synonym(s): ** light ** a photon == Reaction(s) know...")
Line 1: Line 1:
 
[[Category:Metabolite]]
 
[[Category:Metabolite]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=THMPT THMPT] ==
+
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=Light Light] ==
−
* smiles:
+
−
** CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)
+
−
* inchi key:
+
−
** InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K
+
 
* common name:
 
* common name:
−
** tetrahydromethanopterin
+
** hν
−
* molecular weight:
+
−
** 773.666   
+
 
* Synonym(s):
 
* Synonym(s):
−
** THMPT
+
** light
−
** 5,6,7,8-tetrahydromethanopterin
+
** a photon
−
** H4MPT
+
  
 
== Reaction(s) known to consume the compound ==
 
== Reaction(s) known to consume the compound ==
 +
* [[TransportSeed_Light]]
 +
* [[PSII-RXN]]
 
== Reaction(s) known to produce the compound ==
 
== Reaction(s) known to produce the compound ==
−
* [[RXN-15635]]
+
* [[TransportSeed_Light]]
 +
* [[RXN-15490]]
 
== Reaction(s) of unknown directionality ==
 
== Reaction(s) of unknown directionality ==
 +
* [[ExchangeSeed_Light]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: common name=hν}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=49791993 49791993]
+
{{#set: common name=light|a photon}}
−
* CHEBI:
+
{{#set: consumed by=TransportSeed_Light|PSII-RXN}}
−
** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58103 58103]
+
{{#set: produced by=TransportSeed_Light|RXN-15490}}
−
* LIGAND-CPD:
+
{{#set: reversible reaction associated=ExchangeSeed_Light}}
−
** [http://www.genome.jp/dbget-bin/www_bget?C01217 C01217]
+
−
* HMDB : HMDB60403
+
−
{{#set: smiles=CC([CH]1(C(C)NC2(=C(N1)C(NC(=N2)N)=O)))NC4(=CC=C(CC(C(C(COC3(C(C(C(COP([O-])(=O)OC(C([O-])=O)CCC([O-])=O)O3)O)O))O)O)O)C=C4)}}
+
−
{{#set: inchi key=InChIKey=SCBIBGUJSMHIAI-LHIIQLEZSA-K}}
+
−
{{#set: common name=tetrahydromethanopterin}}
+
−
{{#set: molecular weight=773.666    }}
+
−
{{#set: common name=THMPT|5,6,7,8-tetrahydromethanopterin|H4MPT}}
+
−
{{#set: produced by=RXN-15635}}
+

Revision as of 22:02, 17 March 2018

Metabolite Light

  • common name:
    • hν
  • Synonym(s):
    • light
    • a photon

Reaction(s) known to consume the compound

Reaction(s) known to produce the compound

Reaction(s) of unknown directionality

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-28_001180&oldid=15524"