Difference between revisions of "Ec-11 000140"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CHORISMATE CHORISMATE] == * smiles: ** C=C(C(=O)[O-])OC1(C(O)C=CC(C([O-])=O)=C1) * inchi key: *...") |
(Created page with "Category:Gene == Gene Ec-06_006860 == * left end position: ** 4623760 * transcription direction: ** NEGATIVE * right end position: ** 4636245 * centisome position: ** 52.7...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-06_006860 == |
− | * | + | * left end position: |
− | ** | + | ** 4623760 |
− | * | + | * transcription direction: |
− | ** | + | ** NEGATIVE |
− | * | + | * right end position: |
− | ** | + | ** 4636245 |
− | * | + | * centisome position: |
− | ** | + | ** 52.79616 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0052_0040 |
+ | ** Esi0052_0040 | ||
+ | ** PYK | ||
− | == | + | == Reactions associated == |
− | + | * [[PEPDEPHOS-RXN]] | |
− | * [[ | + | ** esiliculosus_genome |
− | == | + | ***ec-number |
− | * [[ | + | * [[RXN-14117]] |
− | * [[ | + | ** esiliculosus_genome |
− | * [[ | + | ***ec-number |
− | * [[ | + | * [[RXN-14192]] |
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | * [[RXN-14207]] | ||
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-1042]] | ||
+ | * [[P341-PWY]] | ||
+ | * [[PWY-2221]] | ||
+ | * [[GLYCOLYSIS]] | ||
+ | * [[PWY-7383]] | ||
+ | * [[NPGLUCAT-PWY]] | ||
+ | * [[ANAGLYCOLYSIS-PWY]] | ||
+ | * [[PWY-7218]] | ||
+ | * [[PWY-6901]] | ||
+ | * [[P124-PWY]] | ||
+ | * [[PWY-6886]] | ||
+ | * [[PWY-5723]] | ||
+ | * [[FERMENTATION-PWY]] | ||
+ | * [[PWY-6142]] | ||
+ | * [[P122-PWY]] | ||
+ | * [[PWY-5484]] | ||
+ | * [[PWY-7003]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4623760}} | |
− | + | {{#set: transcription direction=NEGATIVE}} | |
− | + | {{#set: right end position=4636245}} | |
− | + | {{#set: centisome position=52.79616 }} | |
− | + | {{#set: common name=Esi_0052_0040|Esi0052_0040|PYK}} | |
− | + | {{#set: reaction associated=PEPDEPHOS-RXN|RXN-14117|RXN-14192|RXN-14207}} | |
− | + | {{#set: pathway associated=PWY-1042|P341-PWY|PWY-2221|GLYCOLYSIS|PWY-7383|NPGLUCAT-PWY|ANAGLYCOLYSIS-PWY|PWY-7218|PWY-6901|P124-PWY|PWY-6886|PWY-5723|FERMENTATION-PWY|PWY-6142|P122-PWY|PWY-5484|PWY-7003}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 22:02, 17 March 2018
Gene Ec-06_006860
- left end position:
- 4623760
- transcription direction:
- NEGATIVE
- right end position:
- 4636245
- centisome position:
- 52.79616
- Synonym(s):
- Esi_0052_0040
- Esi0052_0040
- PYK
Reactions associated
- PEPDEPHOS-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-14117
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-14192
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-14207
- esiliculosus_genome
- ec-number
- esiliculosus_genome
Pathways associated
- PWY-1042
- P341-PWY
- PWY-2221
- GLYCOLYSIS
- PWY-7383
- NPGLUCAT-PWY
- ANAGLYCOLYSIS-PWY
- PWY-7218
- PWY-6901
- P124-PWY
- PWY-6886
- PWY-5723
- FERMENTATION-PWY
- PWY-6142
- P122-PWY
- PWY-5484
- PWY-7003