Difference between revisions of "RXN-15271"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=DAMP DAMP] == * smiles: ** C(C3(C(CC(N2(C1(=C(C(=NC=N1)N)N=C2)))O3)O))OP([O-])([O-])=O * inchi...") |
(Created page with "Category:Reaction == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12570 RXN-12570] == * direction: ** LEFT-TO-RIGHT * common name: ** 6-phosphogluconate dehydrog...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Reaction]] |
− | == | + | == Reaction [http://metacyc.org/META/NEW-IMAGE?object=RXN-12570 RXN-12570] == |
− | + | * direction: | |
− | + | ** LEFT-TO-RIGHT | |
− | * | + | |
− | ** | + | |
* common name: | * common name: | ||
− | ** | + | ** 6-phosphogluconate dehydrogenase, C-terminal-like |
− | * | + | ** 3-hydroxyacyl-CoA dehydrogenase |
− | ** | + | * ec number: |
+ | ** [http://enzyme.expasy.org/EC/1.1.1.35 EC-1.1.1.35] | ||
* Synonym(s): | * Synonym(s): | ||
− | |||
− | |||
− | |||
− | |||
− | == Reaction | + | == Reaction Formula == |
− | = | + | * With identifiers: |
− | * [[ | + | ** 1 [[NADH]][c] '''+''' 1 [[PROTON]][c] '''+''' 1 [[K-HEXANOYL-COA]][c] '''=>''' 1 [[OH-HEXANOYL-COA]][c] '''+''' 1 [[NAD]][c] |
− | == | + | * With common name(s): |
− | * [[ | + | ** 1 NADH[c] '''+''' 1 H+[c] '''+''' 1 3-oxohexanoyl-CoA[c] '''=>''' 1 (S)-3-hydroxyhexanoyl-CoA[c] '''+''' 1 NAD+[c] |
+ | |||
+ | == Genes associated with this reaction == | ||
+ | Genes have been associated with this reaction based on different elements listed below. | ||
+ | * [[Ec-19_005290]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***EC-NUMBER | ||
+ | * [[Ec-14_006530]] | ||
+ | ** ESILICULOSUS_GENOME | ||
+ | ***GO-TERM | ||
+ | ** [[pantograph]]-[[aragem]] | ||
+ | == Pathways == | ||
+ | * [[PWY-6863]], pyruvate fermentation to hexanol (engineered): [http://metacyc.org/META/NEW-IMAGE?object=PWY-6863 PWY-6863] | ||
+ | ** '''7''' reactions found over '''11''' reactions in the full pathway | ||
+ | == Reconstruction information == | ||
+ | * Category: [[orthology]] | ||
+ | ** Source: [[orthology-aragem]] | ||
+ | *** Tool: [[pantograph]] | ||
+ | * Category: [[annotation]] | ||
+ | ** Source: [[annotation-esiliculosus_genome]] | ||
+ | *** Tool: [[pathwaytools]] | ||
== External links == | == External links == | ||
− | * | + | * RHEA: |
− | + | ** [http://www.ebi.ac.uk/rhea/reaction.xhtml?id=31144 31144] | |
− | + | * LIGAND-RXN: | |
− | ** [http:// | + | ** [http://www.genome.jp/dbget-bin/www_bget?R04748 R04748] |
− | + | {{#set: direction=LEFT-TO-RIGHT}} | |
− | * LIGAND- | + | {{#set: common name=6-phosphogluconate dehydrogenase, C-terminal-like}} |
− | ** [http://www.genome.jp/dbget-bin/www_bget? | + | {{#set: common name=3-hydroxyacyl-CoA dehydrogenase}} |
− | + | {{#set: ec number=EC-1.1.1.35}} | |
− | + | {{#set: gene associated=Ec-19_005290|Ec-14_006530}} | |
− | + | {{#set: in pathway=PWY-6863}} | |
− | + | {{#set: reconstruction category=orthology|annotation}} | |
− | + | {{#set: reconstruction source=annotation-esiliculosus_genome|orthology-aragem}} | |
− | {{#set: | + | {{#set: reconstruction tool=pantograph|pathwaytools}} |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 23:03, 17 March 2018
Contents
Reaction RXN-12570
- direction:
- LEFT-TO-RIGHT
- common name:
- 6-phosphogluconate dehydrogenase, C-terminal-like
- 3-hydroxyacyl-CoA dehydrogenase
- ec number:
- Synonym(s):
Reaction Formula
- With identifiers:
- 1 NADH[c] + 1 PROTON[c] + 1 K-HEXANOYL-COA[c] => 1 OH-HEXANOYL-COA[c] + 1 NAD[c]
- With common name(s):
- 1 NADH[c] + 1 H+[c] + 1 3-oxohexanoyl-CoA[c] => 1 (S)-3-hydroxyhexanoyl-CoA[c] + 1 NAD+[c]
Genes associated with this reaction
Genes have been associated with this reaction based on different elements listed below.
- Ec-19_005290
- ESILICULOSUS_GENOME
- EC-NUMBER
- ESILICULOSUS_GENOME
- Ec-14_006530
- ESILICULOSUS_GENOME
- GO-TERM
- pantograph-aragem
- ESILICULOSUS_GENOME
Pathways
- PWY-6863, pyruvate fermentation to hexanol (engineered): PWY-6863
- 7 reactions found over 11 reactions in the full pathway
Reconstruction information
- Category: orthology
- Source: orthology-aragem
- Tool: pantograph
- Source: orthology-aragem
- Category: annotation
- Source: annotation-esiliculosus_genome
- Tool: pathwaytools
- Source: annotation-esiliculosus_genome
External links