Difference between revisions of "Ec-09 003670"

From metabolic_network
Jump to: navigation, search
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] == * smiles: ** CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(...")
 
(Created page with "Category:Gene == Gene Ec-17_004310 == * left end position: ** 4692465 * transcription direction: ** NEGATIVE * right end position: ** 4695830 * centisome position: ** 97.8...")
Line 1: Line 1:
−
[[Category:Metabolite]]
+
[[Category:Gene]]
−
== Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-11522 CPD-11522] ==
+
== Gene Ec-17_004310 ==
−
* smiles:
+
* left end position:
−
** CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)
+
** 4692465
−
* inchi key:
+
* transcription direction:
−
** InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J
+
** NEGATIVE
−
* common name:
+
* right end position:
−
** OPC6-trans-2-enoyl-CoA
+
** 4695830
−
* molecular weight:
+
* centisome position:
−
** 1009.851    
+
** 97.80152    
 
* Synonym(s):
 
* Synonym(s):
 +
** Esi_0353_0017
 +
** Esi0353_0017
  
−
== Reaction(s) known to consume the compound ==
+
== Reactions associated ==
−
* [[RXN-10704]]
+
* [[AGMATIN-RXN]]
−
== Reaction(s) known to produce the compound ==
+
** esiliculosus_genome
−
* [[RXN-10706]]
+
***ec-number
−
== Reaction(s) of unknown directionality ==
+
== Pathways associated ==
 +
* [[PWY-6305]]
 +
* [[PWY0-823]]
 +
* [[PWY-40]]
 
== External links  ==
 
== External links  ==
−
* PUBCHEM:
+
{{#set: left end position=4692465}}
−
** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=44237321 44237321]
+
{{#set: transcription direction=NEGATIVE}}
−
{{#set: smiles=CCC=CCC4(C(=O)CCC(CCCC=CC(SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-])=O)4)}}
+
{{#set: right end position=4695830}}
−
{{#set: inchi key=InChIKey=IEENEQSEOWXDQK-JXVDQXHRSA-J}}
+
{{#set: centisome position=97.80152    }}
−
{{#set: common name=OPC6-trans-2-enoyl-CoA}}
+
{{#set: common name=Esi_0353_0017|Esi0353_0017}}
−
{{#set: molecular weight=1009.851    }}
+
{{#set: reaction associated=AGMATIN-RXN}}
−
{{#set: consumed by=RXN-10704}}
+
{{#set: pathway associated=PWY-6305|PWY0-823|PWY-40}}
−
{{#set: produced by=RXN-10706}}
+

Revision as of 22:04, 17 March 2018

Gene Ec-17_004310

  • left end position:
    • 4692465
  • transcription direction:
    • NEGATIVE
  • right end position:
    • 4695830
  • centisome position:
    • 97.80152
  • Synonym(s):
    • Esi_0353_0017
    • Esi0353_0017

Reactions associated

Pathways associated

External links

Retrieved from "http://gem-aureme.irisa.fr/ectogem/index.php?title=Ec-09_003670&oldid=15646"