Difference between revisions of "TRIMETHYLSULFONIUM"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-27_003020 == * left end position: ** 2647405 * transcription direction: ** POSITIVE * right end position: ** 2660378 * centisome position: ** 41.0...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == * smiles: ** C(OP(=O)([O-])[O-])C(OP(=O)([O-])[...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=23-DIPHOSPHOGLYCERATE 23-DIPHOSPHOGLYCERATE] == |
− | * | + | * smiles: |
− | ** | + | ** C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I |
− | * | + | * common name: |
− | ** | + | ** 2,3-diphospho-D-glycerate |
− | * | + | * molecular weight: |
− | ** | + | ** 260.998 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** 2,3-bisphosphoglycerate |
− | ** | + | ** D-Greenwald ester |
− | ** | + | ** 2,3-P2-D-glycerate |
+ | ** 2,3-bisphospho-D-glycerate | ||
+ | ** 2,3-diphosphoglycerate | ||
+ | ** DPG | ||
+ | ** 2,3-bisPGA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | * [[ | + | == Reaction(s) known to produce the compound == |
− | * | + | == Reaction(s) of unknown directionality == |
− | * | + | * [[RXN-15512]] |
− | + | * [[RXN-15509]] | |
+ | * [[RXN-15510]] | ||
+ | * [[RXN-15511]] | ||
== External links == | == External links == | ||
− | {{#set: | + | * LIGAND-CPD: |
− | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C01159 C01159] |
− | {{#set: | + | * CHEBI: |
− | {{#set: | + | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=58248 58248] |
− | {{#set: common name= | + | * METABOLIGHTS : MTBLC58248 |
− | {{#set: reaction associated= | + | * PUBCHEM: |
+ | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25200383 25200383] | ||
+ | * HMDB : HMDB01294 | ||
+ | {{#set: smiles=C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-]}} | ||
+ | {{#set: inchi key=InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I}} | ||
+ | {{#set: common name=2,3-diphospho-D-glycerate}} | ||
+ | {{#set: molecular weight=260.998 }} | ||
+ | {{#set: common name=2,3-bisphosphoglycerate|D-Greenwald ester|2,3-P2-D-glycerate|2,3-bisphospho-D-glycerate|2,3-diphosphoglycerate|DPG|2,3-bisPGA}} | ||
+ | {{#set: reversible reaction associated=RXN-15512|RXN-15509|RXN-15510|RXN-15511}} |
Revision as of 22:04, 17 March 2018
Contents
Metabolite 23-DIPHOSPHOGLYCERATE
- smiles:
- C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-]
- inchi key:
- InChIKey=XOHUEYCVLUUEJJ-UWTATZPHSA-I
- common name:
- 2,3-diphospho-D-glycerate
- molecular weight:
- 260.998
- Synonym(s):
- 2,3-bisphosphoglycerate
- D-Greenwald ester
- 2,3-P2-D-glycerate
- 2,3-bisphospho-D-glycerate
- 2,3-diphosphoglycerate
- DPG
- 2,3-bisPGA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"C(OP(=O)([O-])[O-])C(OP(=O)([O-])[O-])C(=O)[O-" cannot be used as a page name in this wiki.