Difference between revisions of "Ec-02 000280"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=LYS LYS] == * smiles: ** C([N+])CCCC([N+])C([O-])=O * inchi key: ** InChIKey=KDXKERNSBIXSRK-YFK...") |
(Created page with "Category:Gene == Gene Ec-09_003670 == * left end position: ** 4175548 * transcription direction: ** POSITIVE * right end position: ** 4176248 * centisome position: ** 74.3...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-09_003670 == |
− | * | + | * left end position: |
− | ** | + | ** 4175548 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 4176248 |
− | * | + | * centisome position: |
− | ** | + | ** 74.38853 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0021_0028 |
− | ** | + | ** Esi0021_0028 |
− | ** | + | ** GST N-ter |
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[GSHTRAN-RXN]] |
− | * [[ | + | ** esiliculosus_genome |
− | * [[ | + | ***ec-number |
− | * [[ | + | * [[GST-RXN]] |
− | == | + | ** esiliculosus_genome |
− | * [[ | + | ***ec-number |
− | + | * [[RXN-13673]] | |
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | * [[RXN-15680]] | ||
+ | ** esiliculosus_genome | ||
+ | ***ec-number | ||
+ | == Pathways associated == | ||
+ | * [[PWY-7112]] | ||
+ | * [[PWY-6842]] | ||
+ | * [[PWY-4061]] | ||
+ | * [[PWY-7533]] | ||
== External links == | == External links == | ||
− | + | {{#set: left end position=4175548}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=4176248}} | |
− | + | {{#set: centisome position=74.38853 }} | |
− | + | {{#set: common name=Esi_0021_0028|Esi0021_0028|GST N-ter}} | |
− | + | {{#set: reaction associated=GSHTRAN-RXN|GST-RXN|RXN-13673|RXN-15680}} | |
− | + | {{#set: pathway associated=PWY-7112|PWY-6842|PWY-4061|PWY-7533}} | |
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | {{#set: | + |
Revision as of 22:05, 17 March 2018
Gene Ec-09_003670
- left end position:
- 4175548
- transcription direction:
- POSITIVE
- right end position:
- 4176248
- centisome position:
- 74.38853
- Synonym(s):
- Esi_0021_0028
- Esi0021_0028
- GST N-ter
Reactions associated
- GSHTRAN-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- GST-RXN
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-13673
- esiliculosus_genome
- ec-number
- esiliculosus_genome
- RXN-15680
- esiliculosus_genome
- ec-number
- esiliculosus_genome