Difference between revisions of "Ec-14 006550"
From metabolic_network
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=HIS HIS] == * smiles: ** C1(NC=NC=1CC(C(=O)[O-])[N+]) * inchi key: ** InChIKey=HNDVDQJCIGZPNO-Y...") |
(Created page with "Category:Gene == Gene Ec-12_001780 == * left end position: ** 1702363 * transcription direction: ** POSITIVE * right end position: ** 1704119 * centisome position: ** 20.4...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Gene]] |
− | == | + | == Gene Ec-12_001780 == |
− | * | + | * left end position: |
− | ** | + | ** 1702363 |
− | * | + | * transcription direction: |
− | ** | + | ** POSITIVE |
− | * | + | * right end position: |
− | ** | + | ** 1704119 |
− | * | + | * centisome position: |
− | ** | + | ** 20.421694 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** Esi_0144_0077 |
− | ** | + | ** Esi0144_0077 |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | == | + | == Reactions associated == |
− | * [[ | + | * [[RXN-14549]] |
− | + | ** esiliculosus_genome | |
− | + | ***automated-name-match | |
− | * | + | == Pathways associated == |
− | + | ||
− | * | + | |
− | * | + | |
− | == | + | |
== External links == | == External links == | ||
− | + | {{#set: left end position=1702363}} | |
− | + | {{#set: transcription direction=POSITIVE}} | |
− | + | {{#set: right end position=1704119}} | |
− | + | {{#set: centisome position=20.421694 }} | |
− | + | {{#set: common name=Esi_0144_0077|Esi0144_0077}} | |
− | + | {{#set: reaction associated=RXN-14549}} | |
− | + | ||
− | + | ||
− | + | ||
− | + | ||
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: | + | |
− | {{#set: common name= | + | |
− | {{#set: | + | |
− | + |
Revision as of 22:05, 17 March 2018
Gene Ec-12_001780
- left end position:
- 1702363
- transcription direction:
- POSITIVE
- right end position:
- 1704119
- centisome position:
- 20.421694
- Synonym(s):
- Esi_0144_0077
- Esi0144_0077
Reactions associated
- RXN-14549
- esiliculosus_genome
- automated-name-match
- esiliculosus_genome