Difference between revisions of "2-Me-Branched-234-Sat-FA"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-18_000430 == * left end position: ** 398930 * transcription direction: ** NEGATIVE * right end position: ** 401435 * centisome position: ** 8.0975...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] == * smiles: ** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC...") |
||
Line 1: | Line 1: | ||
− | [[Category: | + | [[Category:Metabolite]] |
− | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=ACRYLYL-COA ACRYLYL-COA] == |
− | * | + | * smiles: |
− | ** | + | ** C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-] |
− | * | + | * inchi key: |
− | ** | + | ** InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J |
− | * | + | * common name: |
− | ** | + | ** acryloyl-CoA |
− | * | + | * molecular weight: |
− | ** | + | ** 817.551 |
* Synonym(s): | * Synonym(s): | ||
− | ** | + | ** acrylyl-coenzyme A |
− | ** | + | ** propenoyl-CoA |
+ | ** acrylyl-CoA | ||
− | == | + | == Reaction(s) known to consume the compound == |
− | + | == Reaction(s) known to produce the compound == | |
− | + | == Reaction(s) of unknown directionality == | |
− | + | * [[RXN-6383]] | |
− | == | + | |
− | * [[ | + | |
== External links == | == External links == | ||
− | {{#set: | + | * CAS : 5776-58-9 |
− | {{#set: | + | * PUBCHEM: |
− | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=45266595 45266595] |
− | {{#set: | + | * HMDB : HMDB02307 |
− | {{#set: common name= | + | * LIGAND-CPD: |
− | {{#set: reaction associated=RXN- | + | ** [http://www.genome.jp/dbget-bin/www_bget?C00894 C00894] |
− | + | * CHEBI: | |
+ | ** [http://www.ebi.ac.uk/chebi/searchId.do?chebiId=57367 57367] | ||
+ | * METABOLIGHTS : MTBLC57367 | ||
+ | {{#set: smiles=C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]}} | ||
+ | {{#set: inchi key=InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J}} | ||
+ | {{#set: common name=acryloyl-CoA}} | ||
+ | {{#set: molecular weight=817.551 }} | ||
+ | {{#set: common name=acrylyl-coenzyme A|propenoyl-CoA|acrylyl-CoA}} | ||
+ | {{#set: reversible reaction associated=RXN-6383}} |
Revision as of 22:05, 17 March 2018
Contents
Metabolite ACRYLYL-COA
- smiles:
- C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-]
- inchi key:
- InChIKey=POODSGUMUCVRTR-IEXPHMLFSA-J
- common name:
- acryloyl-CoA
- molecular weight:
- 817.551
- Synonym(s):
- acrylyl-coenzyme A
- propenoyl-CoA
- acrylyl-CoA
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
- CAS : 5776-58-9
- PUBCHEM:
- HMDB : HMDB02307
- LIGAND-CPD:
- CHEBI:
- METABOLIGHTS : MTBLC57367
"C=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(OP(=O)(OCC1(C(OP([O-])(=O)[O-])C(O)C(O1)N3(C2(=C(C(N)=NC=N2)N=C3))))[O-])[O-" cannot be used as a page name in this wiki.