Difference between revisions of "EIF5A-HYPUSINE"
From metabolic_network
(Created page with "Category:Gene == Gene Ec-03_000930 == * left end position: ** 1121209 * transcription direction: ** NEGATIVE * right end position: ** 1130293 * centisome position: ** 17.1...") |
(Created page with "Category:Metabolite == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == * smiles: ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CC...") |
||
| Line 1: | Line 1: | ||
| − | [[Category: | + | [[Category:Metabolite]] |
| − | == | + | == Metabolite [http://metacyc.org/META/NEW-IMAGE?object=CPD-710 CPD-710] == |
| − | * | + | * smiles: |
| − | ** | + | ** CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34)))) |
| − | * | + | * inchi key: |
| − | ** | + | ** InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N |
| − | * | + | * common name: |
| − | ** | + | ** campestanol |
| − | * | + | * molecular weight: |
| − | ** | + | ** 402.702 |
* Synonym(s): | * Synonym(s): | ||
| − | ** | + | ** 5α-campestanol |
| − | + | ||
| − | == | + | == Reaction(s) known to consume the compound == |
| − | * [[ | + | * [[RXN-773]] |
| − | + | == Reaction(s) known to produce the compound == | |
| − | + | == Reaction(s) of unknown directionality == | |
| − | == | + | |
== External links == | == External links == | ||
| − | {{#set: | + | * PUBCHEM: |
| − | {{#set: | + | ** [http://pubchem.ncbi.nlm.nih.gov/summary/summary.cgi?cid=25202034 25202034] |
| − | {{#set: | + | * LIGAND-CPD: |
| − | {{#set: | + | ** [http://www.genome.jp/dbget-bin/www_bget?C15787 C15787] |
| − | {{#set: common name= | + | {{#set: smiles=CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))}} |
| − | {{#set: | + | {{#set: inchi key=InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N}} |
| + | {{#set: common name=campestanol}} | ||
| + | {{#set: molecular weight=402.702 }} | ||
| + | {{#set: common name=5α-campestanol}} | ||
| + | {{#set: consumed by=RXN-773}} | ||
Revision as of 22:06, 17 March 2018
Contents
Metabolite CPD-710
- smiles:
- CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))
- inchi key:
- InChIKey=ARYTXMNEANMLMU-ATEDBJNTSA-N
- common name:
- campestanol
- molecular weight:
- 402.702
- Synonym(s):
- 5α-campestanol
Reaction(s) known to consume the compound
Reaction(s) known to produce the compound
Reaction(s) of unknown directionality
External links
"CC(C)C(C)CCC(C)[CH]3(CC[CH]4([CH]2(CC[CH]1(CC(O)CCC(C)1[CH]2CCC(C)34))))" cannot be used as a page name in this wiki.
